<?php
if (!function_exists('PrintHexBytes')) {
function PrintHexBytes($string) {
$returnstring = '';
for ($i = 0; $i < strlen($string); $i++) {
$returnstring .= str_pad(dechex(ord(substr($string, $i, 1))), 2, '0', STR_PAD_LEFT).' ';
}
return $returnstring;
}
}
if (!function_exists('PrintTextBytes')) {
function PrintTextBytes($string) {
$returnstring = '';
for ($i = 0; $i < strlen($string); $i++) {
if (ord(substr($string, $i, 1)) <= 31) {
$returnstring .= ' ';
} else {
$returnstring .= ' '.substr($string, $i, 1).' ';
}
}
return $returnstring;
}
}
if (!function_exists('FixDBFields')) {
function FixDBFields($text) {
return mysql_escape_string($text);
}
}
if (!function_exists('FixTextFields')) {
function FixTextFields($text) {
$text = SafeStripSlashes($text);
$text = htmlentities($text, ENT_QUOTES);
return $text;
}
}
if (!function_exists('SafeStripSlashes')) {
function SafeStripSlashes($text) {
if (get_magic_quotes_gpc()) {
return stripslashes($text);
}
return $text;
}
}
if (!function_exists('table_var_dump')) {
function table_var_dump($variable) {
$returnstring = '';
switch (gettype($variable)) {
case 'array':
$returnstring .= '<TABLE BORDER="1" CELLSPACING="0" CELLPADDING="2">';
foreach ($variable as $key => $value) {
$returnstring .= '<TR><TD VALIGN="TOP"><B>'.str_replace(chr(0), ' ', $key).'</B></TD>';
$returnstring .= '<TD VALIGN="TOP">'.gettype($value);
if (is_array($value)) {
$returnstring .= ' ('.count($value).')';
} elseif (is_string($value)) {
$returnstring .= ' ('.strlen($value).')';
}
if (($key == 'data') && isset($variable['image_mime']) && isset($variable['dataoffset'])) {
require_once(GETID3_INCLUDEPATH.'getid3.getimagesize.php');
$imageinfo = array();
$imagechunkcheck = GetDataImageSize($value, $imageinfo);
$DumpedImageSRC = (!empty($_REQUEST['filename']) ? $_REQUEST['filename'] : '.getid3').'.'.$variable['dataoffset'].'.'.ImageTypesLookup($imagechunkcheck[2]);
if ($tempimagefile = fopen($DumpedImageSRC, 'wb')) {
fwrite($tempimagefile, $value);
fclose($tempimagefile);
}
$returnstring .= '</TD><TD><IMG SRC="'.$DumpedImageSRC.'" WIDTH="'.$imagechunkcheck[0].'" HEIGHT="'.$imagechunkcheck[1].'"></TD></TR>';
} else {
$returnstring .= '</TD><TD>'.table_var_dump($value).'</TD></TR>';
}
}
$returnstring .= '</TABLE>';
break;
case 'boolean':
$returnstring .= ($variable ? 'TRUE' : 'FALSE');
break;
case 'integer':
case 'double':
case 'float':
$returnstring .= $variable;
break;
case 'object':
case 'null':
$returnstring .= string_var_dump($variable);
break;
case 'string':
$variable = str_replace(chr(0), ' ', $variable);
$varlen = strlen($variable);
for ($i = 0; $i < $varlen; $i++) {
if (ereg('['.chr(0x0A).chr(0x0D).' -;0-9A-Za-z]', $variable{$i})) {
$returnstring .= $variable{$i};
} else {
$returnstring .= '&#'.str_pad(ord($variable{$i}), 3, '0', STR_PAD_LEFT).';';
}
}
$returnstring = nl2br($returnstring);
break;
default:
require_once(GETID3_INCLUDEPATH.'getid3.getimagesize.php');
$imageinfo = array();
$imagechunkcheck = GetDataImageSize(substr($variable, 0, FREAD_BUFFER_SIZE), $imageinfo);
if (($imagechunkcheck[2] >= 1) && ($imagechunkcheck[2] <= 3)) {
$returnstring .= '<TABLE BORDER="1" CELLSPACING="0" CELLPADDING="2">';
$returnstring .= '<TR><TD><B>type</B></TD><TD>'.ImageTypesLookup($imagechunkcheck[2]).'</TD></TR>';
$returnstring .= '<TR><TD><B>width</B></TD><TD>'.number_format($imagechunkcheck[0]).' px</TD></TR>';
$returnstring .= '<TR><TD><B>height</B></TD><TD>'.number_format($imagechunkcheck[1]).' px</TD></TR>';
$returnstring .= '<TR><TD><B>size</B></TD><TD>'.number_format(strlen($variable)).' bytes</TD></TR></TABLE>';
} else {
$returnstring .= nl2br(htmlspecialchars(str_replace(chr(0), ' ', $variable)));
}
break;
}
return $returnstring;
}
}
if (!function_exists('string_var_dump')) {
function string_var_dump($variable) {
ob_start();
var_dump($variable);
$dumpedvariable = ob_get_contents();
ob_end_clean();
return $dumpedvariable;
}
}
if (!function_exists('fileextension')) {
function fileextension($filename, $numextensions=1) {
if (strstr($filename, '.')) {
$reversedfilename = strrev($filename);
$offset = 0;
for ($i = 0; $i < $numextensions; $i++) {
$offset = strpos($reversedfilename, '.', $offset + 1);
if ($offset === false) {
return '';
}
}
return strrev(substr($reversedfilename, 0, $offset));
}
return '';
}
}
if (!function_exists('RemoveAccents')) {
function RemoveAccents($string) {
// return strtr($string, '¥µÀÁÂÃÄÅÆÇÈÉÊËÌÍÎÏÐÑÒÓÔÕÖØÙÚÛÜÝßàáâãäåæçèéêëìíîïðñòóôõöøùúûüýÿ', 'SOZsozYYuAAAAAAACEEEEIIIIDNOOOOOOUUUUYsaaaaaaaceeeeiiiionoooooouuuuyy');
// Revised version by hide@address.com
return strtr(strtr($string, 'ÀÁÂÃÄÅÇÈÉÊËÌÍÎÏÑÒÓÔÕÖØÙÚÛÜÝàáâãäåçèéêëìíîïñòóôõöøùúûüýÿ', 'SZszYAAAAAACEEEEIIIINOOOOOOUUUUYaaaaaaceeeeiiiinoooooouuuuyy'), array('Þ' => 'TH', 'þ' => 'th', 'Ð' => 'DH', 'ð' => 'dh', 'ß' => 'ss', '' => 'OE', '' => 'oe', 'Æ' => 'AE', 'æ' => 'ae', 'µ' => 'u'));
}
}
if (!function_exists('MoreNaturalSort')) {
function MoreNaturalSort($ar1, $ar2) {
if ($ar1 === $ar2) {
return 0;
}
$len1 = strlen($ar1);
$len2 = strlen($ar2);
$shortest = min($len1, $len2);
if (substr($ar1, 0, $shortest) === substr($ar2, 0, $shortest)) {
// the shorter argument is the beginning of the longer one, like "str" and "string"
if ($len1 < $len2) {
return -1;
} elseif ($len1 > $len2) {
return 1;
}
return 0;
}
$ar1 = RemoveAccents(strtolower(trim($ar1)));
$ar2 = RemoveAccents(strtolower(trim($ar2)));
$translatearray = array('\''=>'', '"'=>'', '_'=>' ', '('=>'', ')'=>'', '-'=>' ', ' '=>' ', '.'=>'', ','=>'');
foreach ($translatearray as $key => $val) {
$ar1 = str_replace($key, $val, $ar1);
$ar2 = str_replace($key, $val, $ar2);
}
if ($ar1 < $ar2) {
return -1;
} elseif ($ar1 > $ar2) {
return 1;
}
return 0;
}
}
if (!function_exists('trunc')) {
function trunc($floatnumber) {
// truncates a floating-point number at the decimal point
// returns int (if possible, otherwise float)
if ($floatnumber >= 1) {
$truncatednumber = floor($floatnumber);
} elseif ($floatnumber <= -1) {
$truncatednumber = ceil($floatnumber);
} else {
$truncatednumber = 0;
}
if ($truncatednumber <= pow(2, 30)) {
$truncatednumber = (int) $truncatednumber;
}
return $truncatednumber;
}
}
if (!function_exists('CastAsInt')) {
function CastAsInt($floatnum) {
// convert to float if not already
$floatnum = (float) $floatnum;
// convert a float to type int, only if possible
if (trunc($floatnum) == $floatnum) {
// it's not floating point
if ($floatnum <= pow(2, 30)) {
// it's within int range
$floatnum = (int) $floatnum;
}
}
return $floatnum;
}
}
if (!function_exists('getmicrotime')) {
function getmicrotime() {
list($usec, $sec) = explode(' ', microtime());
return ((float) $usec + (float) $sec);
}
}
if (!function_exists('DecimalBinary2Float')) {
function DecimalBinary2Float($binarynumerator) {
$numerator = Bin2Dec($binarynumerator);
$denominator = Bin2Dec(str_repeat('1', strlen($binarynumerator)));
return ($numerator / $denominator);
}
}
if (!function_exists('NormalizeBinaryPoint')) {
function NormalizeBinaryPoint($binarypointnumber, $maxbits=52) {
// http://www.scri.fsu.edu/~jac/MAD3401/Backgrnd/binary.html
if (strpos($binarypointnumber, '.') === false) {
$binarypointnumber = '0.'.$binarypointnumber;
} elseif ($binarypointnumber{0} == '.') {
$binarypointnumber = '0'.$binarypointnumber;
}
$exponent = 0;
while (($binarypointnumber{0} != '1') || (substr($binarypointnumber, 1, 1) != '.')) {
if (substr($binarypointnumber, 1, 1) == '.') {
$exponent--;
$binarypointnumber = substr($binarypointnumber, 2, 1).'.'.substr($binarypointnumber, 3);
} else {
$pointpos = strpos($binarypointnumber, '.');
$exponent += ($pointpos - 1);
$binarypointnumber = str_replace('.', '', $binarypointnumber);
$binarypointnumber = $binarypointnumber{0}.'.'.substr($binarypointnumber, 1);
}
}
$binarypointnumber = str_pad(substr($binarypointnumber, 0, $maxbits + 2), $maxbits + 2, '0', STR_PAD_RIGHT);
return array('normalized'=>$binarypointnumber, 'exponent'=>(int) $exponent);
}
}
if (!function_exists('Float2BinaryDecimal')) {
function Float2BinaryDecimal($floatvalue) {
// http://www.scri.fsu.edu/~jac/MAD3401/Backgrnd/binary.html
$maxbits = 128; // to how many bits of precision should the calculations be taken?
$intpart = trunc($floatvalue);
$floatpart = abs($floatvalue - $intpart);
$pointbitstring = '';
while (($floatpart != 0) && (strlen($pointbitstring) < $maxbits)) {
$floatpart *= 2;
$pointbitstring .= (string) trunc($floatpart);
$floatpart -= trunc($floatpart);
}
$binarypointnumber = decbin($intpart).'.'.$pointbitstring;
return $binarypointnumber;
}
}
if (!function_exists('Float2String')) {
function Float2String($floatvalue, $bits) {
// http://www.scri.fsu.edu/~jac/MAD3401/Backgrnd/ieee-expl.html
switch ($bits) {
case 32:
$exponentbits = 8;
$fractionbits = 23;
break;
case 64:
$exponentbits = 11;
$fractionbits = 52;
break;
default:
return false;
break;
}
if ($floatvalue >= 0) {
$signbit = '0';
} else {
$signbit = '1';
}
$normalizedbinary = NormalizeBinaryPoint(Float2BinaryDecimal($floatvalue), $fractionbits);
$biasedexponent = pow(2, $exponentbits - 1) - 1 + $normalizedbinary['exponent']; // (127 or 1023) +/- exponent
$exponentbitstring = str_pad(decbin($biasedexponent), $exponentbits, '0', STR_PAD_LEFT);
$fractionbitstring = str_pad(substr($normalizedbinary['normalized'], 2), $fractionbits, '0', STR_PAD_RIGHT);
return BigEndian2String(Bin2Dec($signbit.$exponentbitstring.$fractionbitstring), $bits % 8, false);
}
}
if (!function_exists('LittleEndian2Float')) {
function LittleEndian2Float($byteword) {
return BigEndian2Float(strrev($byteword));
}
}
if (!function_exists('BigEndian2Float')) {
function BigEndian2Float($byteword) {
// ANSI/IEEE Standard 754-1985, Standard for Binary Floating Point Arithmetic
// http://www.psc.edu/general/software/packages/ieee/ieee.html
// http://www.scri.fsu.edu/~jac/MAD3401/Backgrnd/ieee.html
$bitword = BigEndian2Bin($byteword);
$signbit = $bitword{0};
switch (strlen($byteword) * 8) {
case 32:
$exponentbits = 8;
$fractionbits = 23;
break;
case 64:
$exponentbits = 11;
$fractionbits = 52;
break;
case 80:
$exponentbits = 16;
$fractionbits = 64;
break;
default:
return false;
break;
}
$exponentstring = substr($bitword, 1, $exponentbits - 1);
$fractionstring = substr($bitword, $exponentbits, $fractionbits);
$exponent = Bin2Dec($exponentstring);
$fraction = Bin2Dec($fractionstring);
if (($exponentbits == 16) && ($fractionbits == 64)) {
// 80-bit
// As used in Apple AIFF for sample_rate
// A bit of a hack, but it works ;)
return pow(2, ($exponent - 16382)) * DecimalBinary2Float($fractionstring);
}
if (($exponent == (pow(2, $exponentbits) - 1)) && ($fraction != 0)) {
// Not a Number
$floatvalue = false;
} elseif (($exponent == (pow(2, $exponentbits) - 1)) && ($fraction == 0)) {
if ($signbit == '1') {
$floatvalue = '-infinity';
} else {
$floatvalue = '+infinity';
}
} elseif (($exponent == 0) && ($fraction == 0)) {
if ($signbit == '1') {
$floatvalue = -0;
} else {
$floatvalue = 0;
}
$floatvalue = ($signbit ? 0 : -0);
} elseif (($exponent == 0) && ($fraction != 0)) {
// These are 'unnormalized' values
$floatvalue = pow(2, (-1 * (pow(2, $exponentbits - 1) - 2))) * DecimalBinary2Float($fractionstring);
if ($signbit == '1') {
$floatvalue *= -1;
}
} elseif ($exponent != 0) {
$floatvalue = pow(2, ($exponent - (pow(2, $exponentbits - 1) - 1))) * (1 + DecimalBinary2Float($fractionstring));
if ($signbit == '1') {
$floatvalue *= -1;
}
}
return (float) $floatvalue;
}
}
if (!function_exists('BigEndian2Int')) {
function BigEndian2Int($byteword, $synchsafe=false, $signed=false) {
$intvalue = 0;
$bytewordlen = strlen($byteword);
for ($i = 0; $i < $bytewordlen; $i++) {
if ($synchsafe) { // disregard MSB, effectively 7-bit bytes
$intvalue = $intvalue | (ord($byteword{$i}) & 0x7F) << (($bytewordlen - 1 - $i) * 7);
} else {
$intvalue += ord($byteword{$i}) * pow(256, ($bytewordlen - 1 - $i));
}
}
if ($signed && !$synchsafe) {
// synchsafe ints are not allowed to be signed
switch ($bytewordlen) {
case 1:
case 2:
case 3:
case 4:
$signmaskbit = 0x80 << (8 * ($bytewordlen - 1));
if ($intvalue & $signmaskbit) {
$intvalue = 0 - ($intvalue & ($signmaskbit - 1));
}
break;
default:
die('ERROR: Cannot have signed integers larger than 32-bits in BigEndian2Int()');
break;
}
}
return CastAsInt($intvalue);
}
}
if (!function_exists('LittleEndian2Int')) {
function LittleEndian2Int($byteword, $signed=false) {
return BigEndian2Int(strrev($byteword), false, $signed);
}
}
if (!function_exists('BigEndian2Bin')) {
function BigEndian2Bin($byteword) {
$binvalue = '';
$bytewordlen = strlen($byteword);
for ($i = 0; $i < $bytewordlen; $i++) {
$binvalue .= str_pad(decbin(ord($byteword{$i})), 8, '0', STR_PAD_LEFT);
}
return $binvalue;
}
}
if (!function_exists('BigEndian2String')) {
function BigEndian2String($number, $minbytes=1, $synchsafe=false, $signed=false) {
if ($number < 0) {
return false;
}
$maskbyte = (($synchsafe || $signed) ? 0x7F : 0xFF);
$intstring = '';
if ($signed) {
if ($minbytes > 4) {
die('ERROR: Cannot have signed integers larger than 32-bits in BigEndian2String()');
}
$number = $number & (0x80 << (8 * ($minbytes - 1)));
}
while ($number != 0) {
$quotient = ($number / ($maskbyte + 1));
$intstring = chr(ceil(($quotient - floor($quotient)) * $maskbyte)).$intstring;
$number = floor($quotient);
}
return str_pad($intstring, $minbytes, chr(0), STR_PAD_LEFT);
}
}
if (!function_exists('Dec2Bin')) {
function Dec2Bin($number) {
while ($number >= 256) {
$bytes[] = (($number / 256) - (floor($number / 256))) * 256;
$number = floor($number / 256);
}
$bytes[] = $number;
$binstring = '';
for ($i = 0; $i < count($bytes); $i++) {
$binstring = (($i == count($bytes) - 1) ? decbin($bytes[$i]) : str_pad(decbin($bytes[$i]), 8, '0', STR_PAD_LEFT)).$binstring;
}
return $binstring;
}
}
if (!function_exists('Bin2Dec')) {
function Bin2Dec($binstring) {
$decvalue = 0;
for ($i = 0; $i < strlen($binstring); $i++) {
$decvalue += ((int) substr($binstring, strlen($binstring) - $i - 1, 1)) * pow(2, $i);
}
return CastAsInt($decvalue);
}
}
if (!function_exists('Bin2String')) {
function Bin2String($binstring) {
// return 'hi' for input of '0110100001101001'
$string = '';
$binstringreversed = strrev($binstring);
for ($i = 0; $i < strlen($binstringreversed); $i += 8) {
$string = chr(Bin2Dec(strrev(substr($binstringreversed, $i, 8)))).$string;
}
return $string;
}
}
if (!function_exists('LittleEndian2String')) {
function LittleEndian2String($number, $minbytes=1, $synchsafe=false) {
$intstring = '';
while ($number > 0) {
if ($synchsafe) {
$intstring = $intstring.chr($number & 127);
$number >>= 7;
} else {
$intstring = $intstring.chr($number & 255);
$number >>= 8;
}
}
return str_pad($intstring, $minbytes, chr(0), STR_PAD_RIGHT);
}
}
if (!function_exists('Bool2IntString')) {
function Bool2IntString($intvalue) {
return ($intvalue ? '1' : '0');
}
}
if (!function_exists('IntString2Bool')) {
function IntString2Bool($char) {
if ($char == '1') {
return true;
} elseif ($char == '0') {
return false;
}
return null;
}
}
if (!function_exists('InverseBoolean')) {
function InverseBoolean($value) {
return ($value ? false : true);
}
}
if (!function_exists('DeUnSynchronise')) {
function DeUnSynchronise($data) {
return str_replace(chr(0xFF).chr(0x00), chr(0xFF), $data);
}
}
if (!function_exists('Unsynchronise')) {
function Unsynchronise($data) {
// Whenever a false synchronisation is found within the tag, one zeroed
// byte is inserted after the first false synchronisation byte. The
// format of a correct sync that should be altered by ID3 encoders is as
// follows:
// %11111111 111xxxxx
// And should be replaced with:
// %11111111 00000000 111xxxxx
// This has the side effect that all $FF 00 combinations have to be
// altered, so they won't be affected by the decoding process. Therefore
// all the $FF 00 combinations have to be replaced with the $FF 00 00
// combination during the unsynchronisation.
$data = str_replace(chr(0xFF).chr(0x00), chr(0xFF).chr(0x00).chr(0x00), $data);
$unsyncheddata = '';
for ($i = 0; $i < strlen($data); $i++) {
$thischar = $data{$i};
$unsyncheddata .= $thischar;
if ($thischar == chr(255)) {
$nextchar = ord(substr($data, $i + 1, 1));
if (($nextchar | 0xE0) == 0xE0) {
// previous byte = 11111111, this byte = 111?????
$unsyncheddata .= chr(0);
}
}
}
return $unsyncheddata;
}
}
if (!function_exists('is_hash')) {
function is_hash($var) {
// written by dev-hide@address.com
// taken from http://www.php.net/manual/en/function.array-merge-recursive.php
if (is_array($var)) {
$keys = array_keys($var);
$all_num = true;
for ($i = 0; $i < count($keys); $i++) {
if (is_string($keys[$i])) {
return true;
}
}
}
return false;
}
}
if (!function_exists('array_join_merge')) {
function array_join_merge($arr1, $arr2) {
// written by dev-hide@address.com
// taken from http://www.php.net/manual/en/function.array-merge-recursive.php
if (is_array($arr1) && is_array($arr2)) {
// the same -> merge
$new_array = array();
if (is_hash($arr1) && is_hash($arr2)) {
// hashes -> merge based on keys
$keys = array_merge(array_keys($arr1), array_keys($arr2));
foreach ($keys as $key) {
$new_array[$key] = array_join_merge(@$arr1[$key], @$arr2[$key]);
}
} else {
// two real arrays -> merge
$new_array = array_reverse(array_unique(array_reverse(array_merge($arr1,$arr2))));
}
return $new_array;
} else {
// not the same ... take new one if defined, else the old one stays
return $arr2 ? $arr2 : $arr1;
}
}
}
if (!function_exists('array_merge_clobber')) {
function array_merge_clobber($array1, $array2) {
// written by hide@address.com
// taken from http://www.php.net/manual/en/function.array-merge-recursive.php
if (!is_array($array1) || !is_array($array2)) {
return false;
}
$newarray = $array1;
foreach ($array2 as $key => $val) {
if (is_array($val) && isset($newarray[$key]) && is_array($newarray[$key])) {
$newarray[$key] = array_merge_clobber($newarray[$key], $val);
} else {
$newarray[$key] = $val;
}
}
return $newarray;
}
}
if (!function_exists('array_merge_noclobber')) {
function array_merge_noclobber($array1, $array2) {
if (!is_array($array1) || !is_array($array2)) {
return false;
}
$newarray = $array1;
foreach ($array2 as $key => $val) {
if (is_array($val) && isset($newarray[$key]) && is_array($newarray[$key])) {
$newarray[$key] = array_merge_noclobber($newarray[$key], $val);
} elseif (!isset($newarray[$key])) {
$newarray[$key] = $val;
}
}
return $newarray;
}
}
if (!function_exists('RoughTranslateUnicodeToASCII')) {
function RoughTranslateUnicodeToASCII($rawdata, $frame_textencoding) {
// rough translation of data for application that can't handle Unicode data
$tempstring = '';
switch ($frame_textencoding) {
case 0: // ISO-8859-1. Terminated with $00.
$asciidata = $rawdata;
break;
case 1: // UTF-16 encoded Unicode with BOM. Terminated with $00 00.
$asciidata = $rawdata;
if (substr($asciidata, 0, 2) == chr(0xFF).chr(0xFE)) {
// remove BOM, only if present (it should be, but...)
$asciidata = substr($asciidata, 2);
}
if (substr($asciidata, strlen($asciidata) - 2, 2) == chr(0).chr(0)) {
$asciidata = substr($asciidata, 0, strlen($asciidata) - 2); // remove terminator, only if present (it should be, but...)
}
for ($i = 0; $i < strlen($asciidata); $i += 2) {
if ((ord($asciidata{$i}) <= 0x7F) || (ord($asciidata{$i}) >= 0xA0)) {
$tempstring .= $asciidata{$i};
} else {
$tempstring .= '?';
}
}
$asciidata = $tempstring;
break;
case 2: // UTF-16BE encoded Unicode without BOM. Terminated with $00 00.
$asciidata = $rawdata;
if (substr($asciidata, strlen($asciidata) - 2, 2) == chr(0).chr(0)) {
$asciidata = substr($asciidata, 0, strlen($asciidata) - 2); // remove terminator, only if present (it should be, but...)
}
for ($i = 0; $i < strlen($asciidata); $i += 2) {
if ((ord($asciidata{$i}) <= 0x7F) || (ord($asciidata{$i}) >= 0xA0)) {
$tempstring .= $asciidata{$i};
} else {
$tempstring .= '?';
}
}
$asciidata = $tempstring;
break;
case 3: // UTF-8 encoded Unicode. Terminated with $00.
$asciidata = utf8_decode($rawdata);
break;
case 255: // Unicode, Big-Endian. Terminated with $00 00.
$asciidata = $rawdata;
if (substr($asciidata, strlen($asciidata) - 2, 2) == chr(0).chr(0)) {
$asciidata = substr($asciidata, 0, strlen($asciidata) - 2); // remove terminator, only if present (it should be, but...)
}
for ($i = 0; ($i + 1) < strlen($asciidata); $i += 2) {
if ((ord($asciidata{($i + 1)}) <= 0x7F) || (ord($asciidata{($i + 1)}) >= 0xA0)) {
$tempstring .= $asciidata{($i + 1)};
} else {
$tempstring .= '?';
}
}
$asciidata = $tempstring;
break;
default:
// shouldn't happen, but in case $frame_textencoding is not 1 <= $frame_textencoding <= 4
// just pass the data through unchanged.
$asciidata = $rawdata;
break;
}
if (substr($asciidata, strlen($asciidata) - 1, 1) == chr(0)) {
// remove null terminator, if present
$asciidata = NoNullString($asciidata);
}
return $asciidata;
// return str_replace(chr(0), '', $asciidata); // just in case any nulls slipped through
}
}
if (!function_exists('PlaytimeString')) {
function PlaytimeString($playtimeseconds) {
$contentseconds = round((($playtimeseconds / 60) - floor($playtimeseconds / 60)) * 60);
$contentminutes = floor($playtimeseconds / 60);
if ($contentseconds >= 60) {
$contentseconds -= 60;
$contentminutes++;
}
return number_format($contentminutes).':'.str_pad($contentseconds, 2, 0, STR_PAD_LEFT);
}
}
if (!function_exists('CloseMatch')) {
function CloseMatch($value1, $value2, $tolerance) {
return (abs($value1 - $value2) <= $tolerance);
}
}
if (!function_exists('ID3v1matchesID3v2')) {
function ID3v1matchesID3v2($id3v1, $id3v2) {
$requiredindices = array('title', 'artist', 'album', 'year', 'genre', 'comment');
foreach ($requiredindices as $requiredindex) {
if (!isset($id3v1["$requiredindex"])) {
$id3v1["$requiredindex"] = '';
}
if (!isset($id3v2["$requiredindex"])) {
$id3v2["$requiredindex"] = '';
}
}
if (trim($id3v1['title']) != trim(substr($id3v2['title'], 0, 30))) {
return false;
}
if (trim($id3v1['artist']) != trim(substr($id3v2['artist'], 0, 30))) {
return false;
}
if (trim($id3v1['album']) != trim(substr($id3v2['album'], 0, 30))) {
return false;
}
if (trim($id3v1['year']) != trim(substr($id3v2['year'], 0, 4))) {
return false;
}
if (trim($id3v1['genre']) != trim($id3v2['genre'])) {
return false;
}
if (isset($id3v1['track'])) {
if (!isset($id3v1['track']) || (trim($id3v1['track']) != trim($id3v2['track']))) {
return false;
}
if (trim($id3v1['comment']) != trim(substr($id3v2['comment'], 0, 28))) {
return false;
}
} else {
if (trim($id3v1['comment']) != trim(substr($id3v2['comment'], 0, 30))) {
return false;
}
}
return true;
}
}
if (!function_exists('FILETIMEtoUNIXtime')) {
function FILETIMEtoUNIXtime($FILETIME, $round=true) {
// FILETIME is a 64-bit unsigned integer representing
// the number of 100-nanosecond intervals since January 1, 1601
// UNIX timestamp is number of seconds since January 1, 1970
// 116444736000000000 = 10000000 * 60 * 60 * 24 * 365 * 369 + 89 leap days
if ($round) {
return round(($FILETIME - 116444736000000000) / 10000000);
}
return ($FILETIME - 116444736000000000) / 10000000;
}
}
if (!function_exists('GUIDtoBytestring')) {
function GUIDtoBytestring($GUIDstring) {
// Microsoft defines these 16-byte (128-bit) GUIDs in the strangest way:
// first 4 bytes are in little-endian order
// next 2 bytes are appended in little-endian order
// next 2 bytes are appended in little-endian order
// next 2 bytes are appended in big-endian order
// next 6 bytes are appended in big-endian order
// AaBbCcDd-EeFf-GgHh-IiJj-KkLlMmNnOoPp is stored as this 16-byte string:
// $Dd $Cc $Bb $Aa $Ff $Ee $Hh $Gg $Ii $Jj $Kk $Ll $Mm $Nn $Oo $Pp
$hexbytecharstring = chr(hexdec(substr($GUIDstring, 6, 2)));
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 4, 2)));
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 2, 2)));
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 0, 2)));
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 11, 2)));
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 9, 2)));
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 16, 2)));
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 14, 2)));
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 19, 2)));
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 21, 2)));
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 24, 2)));
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 26, 2)));
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 28, 2)));
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 30, 2)));
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 32, 2)));
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 34, 2)));
return $hexbytecharstring;
}
}
if (!function_exists('BytestringToGUID')) {
function BytestringToGUID($Bytestring) {
$GUIDstring = str_pad(dechex(ord($Bytestring{3})), 2, '0', STR_PAD_LEFT);
$GUIDstring .= str_pad(dechex(ord($Bytestring{2})), 2, '0', STR_PAD_LEFT);
$GUIDstring .= str_pad(dechex(ord($Bytestring{1})), 2, '0', STR_PAD_LEFT);
$GUIDstring .= str_pad(dechex(ord($Bytestring{0})), 2, '0', STR_PAD_LEFT);
$GUIDstring .= '-';
$GUIDstring .= str_pad(dechex(ord($Bytestring{5})), 2, '0', STR_PAD_LEFT);
$GUIDstring .= str_pad(dechex(ord($Bytestring{4})), 2, '0', STR_PAD_LEFT);
$GUIDstring .= '-';
$GUIDstring .= str_pad(dechex(ord($Bytestring{7})), 2, '0', STR_PAD_LEFT);
$GUIDstring .= str_pad(dechex(ord($Bytestring{6})), 2, '0', STR_PAD_LEFT);
$GUIDstring .= '-';
$GUIDstring .= str_pad(dechex(ord($Bytestring{8})), 2, '0', STR_PAD_LEFT);
$GUIDstring .= str_pad(dechex(ord($Bytestring{9})), 2, '0', STR_PAD_LEFT);
$GUIDstring .= '-';
$GUIDstring .= str_pad(dechex(ord($Bytestring{10})), 2, '0', STR_PAD_LEFT);
$GUIDstring .= str_pad(dechex(ord($Bytestring{11})), 2, '0', STR_PAD_LEFT);
$GUIDstring .= str_pad(dechex(ord($Bytestring{12})), 2, '0', STR_PAD_LEFT);
$GUIDstring .= str_pad(dechex(ord($Bytestring{13})), 2, '0', STR_PAD_LEFT);
$GUIDstring .= str_pad(dechex(ord($Bytestring{14})), 2, '0', STR_PAD_LEFT);
$GUIDstring .= str_pad(dechex(ord($Bytestring{15})), 2, '0', STR_PAD_LEFT);
return strtoupper($GUIDstring);
}
}
if (!function_exists('BitrateColor')) {
function BitrateColor($bitrate) {
$bitrate /= 3; // scale from 1-768kbps to 1-256kbps
$bitrate--; // scale from 1-256kbps to 0-255kbps
$bitrate = max($bitrate, 0);
$bitrate = min($bitrate, 255);
//$bitrate = max($bitrate, 32);
//$bitrate = min($bitrate, 143);
//$bitrate = ($bitrate * 2) - 32;
$Rcomponent = max(255 - ($bitrate * 2), 0);
$Gcomponent = max(($bitrate * 2) - 255, 0);
if ($bitrate > 127) {
$Bcomponent = max((255 - $bitrate) * 2, 0);
} else {
$Bcomponent = max($bitrate * 2, 0);
}
return str_pad(dechex($Rcomponent), 2, '0', STR_PAD_LEFT).str_pad(dechex($Gcomponent), 2, '0', STR_PAD_LEFT).str_pad(dechex($Bcomponent), 2, '0', STR_PAD_LEFT);
}
}
if (!function_exists('BitrateText')) {
function BitrateText($bitrate) {
return '<SPAN STYLE="color: #'.BitrateColor($bitrate).'">'.round($bitrate).' kbps</SPAN>';
}
}
if (!function_exists('image_type_to_mime_type')) {
function image_type_to_mime_type($imagetypeid) {
// only available in PHP v4.3.0+
static $image_type_to_mime_type = array();
if (empty($image_type_to_mime_type)) {
$image_type_to_mime_type[1] = 'image/gif'; // GIF
$image_type_to_mime_type[2] = 'image/jpeg'; // JPEG
$image_type_to_mime_type[3] = 'image/png'; // PNG
$image_type_to_mime_type[4] = 'application/x-shockwave-flash'; // Flash
$image_type_to_mime_type[5] = 'image/psd'; // PSD
$image_type_to_mime_type[6] = 'image/bmp'; // BMP
$image_type_to_mime_type[7] = 'image/tiff'; // TIFF: little-endian (Intel)
$image_type_to_mime_type[8] = 'image/tiff'; // TIFF: big-endian (Motorola)
//$image_type_to_mime_type[9] = 'image/jpc'; // JPC
//$image_type_to_mime_type[10] = 'image/jp2'; // JPC
//$image_type_to_mime_type[11] = 'image/jpx'; // JPC
//$image_type_to_mime_type[12] = 'image/jb2'; // JPC
$image_type_to_mime_type[13] = 'application/x-shockwave-flash'; // Shockwave
$image_type_to_mime_type[14] = 'image/iff'; // IFF
}
return (isset($image_type_to_mime_type[$imagetypeid]) ? $image_type_to_mime_type[$imagetypeid] : 'application/octet-stream');
}
}
if (!function_exists('utf8_decode')) {
// PHP has this function built-in if it's configured with the --with-xml option
// This version of the function is only provided in case XML isn't installed
function utf8_decode($utf8text) {
// http://www.php.net/manual/en/function.utf8-encode.php
// bytes bits representation
// 1 7 0bbbbbbb
// 2 11 110bbbbb 10bbbbbb
// 3 16 1110bbbb 10bbbbbb 10bbbbbb
// 4 21 11110bbb 10bbbbbb 10bbbbbb 10bbbbbb
$utf8length = strlen($utf8text);
$decodedtext = '';
for ($i = 0; $i < $utf8length; $i++) {
if ((ord($utf8text{$i}) & 0x80) == 0) {
$decodedtext .= $utf8text{$i};
} elseif ((ord($utf8text{$i}) & 0xF0) == 0xF0) {
$decodedtext .= '?';
$i += 3;
} elseif ((ord($utf8text{$i}) & 0xE0) == 0xE0) {
$decodedtext .= '?';
$i += 2;
} elseif ((ord($utf8text{$i}) & 0xC0) == 0xC0) {
// 2 11 110bbbbb 10bbbbbb
$decodedchar = Bin2Dec(substr(Dec2Bin(ord($utf8text{$i})), 3, 5).substr(Dec2Bin(ord($utf8text{($i + 1)})), 2, 6));
if ($decodedchar <= 255) {
$decodedtext .= chr($decodedchar);
} else {
$decodedtext .= '?';
}
$i += 1;
}
}
return $decodedtext;
}
}
if (!function_exists('DateMac2Unix')) {
function DateMac2Unix($macdate) {
// Macintosh timestamp: seconds since 00:00h January 1, 1904
// UNIX timestamp: seconds since 00:00h January 1, 1970
return CastAsInt($macdate - 2082844800);
}
}
if (!function_exists('FixedPoint8_8')) {
function FixedPoint8_8($rawdata) {
return BigEndian2Int(substr($rawdata, 0, 1)) + (float) (BigEndian2Int(substr($rawdata, 1, 1)) / pow(2, 8));
}
}
if (!function_exists('FixedPoint16_16')) {
function FixedPoint16_16($rawdata) {
return BigEndian2Int(substr($rawdata, 0, 2)) + (float) (BigEndian2Int(substr($rawdata, 2, 2)) / pow(2, 16));
}
}
if (!function_exists('FixedPoint2_30')) {
function FixedPoint2_30($rawdata) {
$binarystring = BigEndian2Bin($rawdata);
return Bin2Dec(substr($binarystring, 0, 2)) + (float) (Bin2Dec(substr($binarystring, 2, 30)) / pow(2, 30));
}
}
if (!function_exists('Pascal2String')) {
function Pascal2String($pascalstring) {
// Pascal strings have 1 byte at the beginning saying how many chars are in the string
return substr($pascalstring, 1);
}
}
if (!function_exists('NoNullString')) {
function NoNullString($nullterminatedstring) {
// remove the single null terminator on null terminated strings
if (substr($nullterminatedstring, strlen($nullterminatedstring) - 1, 1) === chr(0)) {
return substr($nullterminatedstring, 0, strlen($nullterminatedstring) - 1);
}
return $nullterminatedstring;
}
}
if (!function_exists('FileSizeNiceDisplay')) {
function FileSizeNiceDisplay($filesize, $precision=2) {
if ($filesize < 1000) {
$sizeunit = 'bytes';
$precision = 0;
} else {
$filesize /= 1024;
$sizeunit = 'kB';
}
if ($filesize >= 1000) {
$filesize /= 1024;
$sizeunit = 'MB';
}
if ($filesize >= 1000) {
$filesize /= 1024;
$sizeunit = 'GB';
}
return number_format($filesize, $precision).' '.$sizeunit;
}
}
if (!function_exists('DOStime2UNIXtime')) {
function DOStime2UNIXtime($DOSdate, $DOStime) {
// wFatDate
// Specifies the MS-DOS date. The date is a packed 16-bit value with the following format:
// Bits Contents
// 0-4 Day of the month (1-31)
// 5-8 Month (1 = January, 2 = February, and so on)
// 9-15 Year offset from 1980 (add 1980 to get actual year)
$UNIXday = ($DOSdate & 0x001F);
$UNIXmonth = (($DOSdate & 0x01E0) >> 5);
$UNIXyear = (($DOSdate & 0xFE00) >> 9) + 1980;
// wFatTime
// Specifies the MS-DOS time. The time is a packed 16-bit value with the following format:
// Bits Contents
// 0-4 Second divided by 2
// 5-10 Minute (0-59)
// 11-15 Hour (0-23 on a 24-hour clock)
$UNIXsecond = ($DOStime & 0x001F) * 2;
$UNIXminute = (($DOStime & 0x07E0) >> 5);
$UNIXhour = (($DOStime & 0xF800) >> 11);
return mktime($UNIXhour, $UNIXminute, $UNIXsecond, $UNIXmonth, $UNIXday, $UNIXyear);
}
}
if (!function_exists('CreateDeepArray')) {
function CreateDeepArray($ArrayPath, $Separator, $Value) {
// assigns $Value to a nested array path:
// $foo = CreateDeepArray('/path/to/my', '/', 'file.txt')
// is the same as:
// $foo = array('path'=>array('to'=>'array('my'=>array('file.txt'))));
// or
// $foo['path']['to']['my'] = 'file.txt';
while ($ArrayPath{0} == $Separator) {
$ArrayPath = substr($ArrayPath, 1);
}
if (($pos = strpos($ArrayPath, $Separator)) !== false) {
$ReturnedArray[substr($ArrayPath, 0, $pos)] = CreateDeepArray(substr($ArrayPath, $pos + 1), $Separator, $Value);
} else {
$ReturnedArray["$ArrayPath"] = $Value;
}
return $ReturnedArray;
}
}
if (!function_exists('md5_file')) {
// Allan Hansen <hide@address.com>
// md5_file() exists in PHP 4.2.0.
// The following works under UNIX only, but dies on windows
function md5_file($file) {
if (substr(php_uname(), 0, 7) == 'Windows') {
die('PHP 4.2.0 or newer required for md5_file()');
}
$file = str_replace('`', '\\`', $file);
if (ereg("^([0-9a-f]{32})[ \t\n\r]", `md5sum "$file"`, $r)) {
return $r[1];
}
return false;
}
}
if (!function_exists('md5_data')) {
// Allan Hansen <hide@address.com>
// md5_data() - returns md5sum for a file from startuing position to absolute end position
function md5_data($file, $offset, $end, $invertsign=false) {
// first try and create a temporary file in the same directory as the file being scanned
if (($dataMD5filename = tempnam(dirname($file), eregi_replace('[^[:alnum:]]', '', basename($file)))) === false) {
// if that fails, create a temporary file in the system temp directory
if (($dataMD5filename = tempnam('/tmp', 'getID3')) === false) {
// if that fails, create a temporary file in the current directory
if (($dataMD5filename = tempnam('.', eregi_replace('[^[:alnum:]]', '', basename($file)))) === false) {
// can't find anywhere to create a temp file, just die
return false;
}
}
}
$md5 = false;
set_time_limit(max(filesize($file) / 1000000, 30));
// copy parts of file
if ($fp = @fopen($file, 'rb')) {
if ($MD5fp = @fopen($dataMD5filename, 'wb')) {
if ($invertsign) {
// Load conversion lookup strings for 8-bit unsigned->signed conversion below
$from = '';
$to = '';
for ($i = 0; $i < 128; $i++) {
$from .= chr($i);
$to .= chr($i + 128);
}
for ($i = 128; $i < 256; $i++) {
$from .= chr($i);
$to .= chr($i - 128);
}
}
fseek($fp, $offset, SEEK_SET);
$byteslefttowrite = $end - $offset;
while (($byteslefttowrite > 0) && ($buffer = fread($fp, FREAD_BUFFER_SIZE))) {
if ($invertsign) {
// Possibly FLAC-specific (?)
// FLAC calculates the MD5sum of the source data of 8-bit files
// not on the actual byte values in the source file, but of those
// values converted from unsigned to signed, or more specifcally,
// with the MSB inverted. ex: 01 -> 81; F5 -> 75; etc
// Therefore, 8-bit WAV data has to be converted before getting the
// md5_data value so as to match the FLAC value
// Flip the MSB for each byte in the buffer before copying
$buffer = strtr($buffer, $from, $to);
}
$byteswritten = fwrite($MD5fp, $buffer, $byteslefttowrite);
$byteslefttowrite -= $byteswritten;
}
fclose($MD5fp);
$md5 = md5_file($dataMD5filename);
}
fclose($fp);
}
unlink($dataMD5filename);
return $md5;
}
}
if (!function_exists('TwosCompliment2Decimal')) {
function TwosCompliment2Decimal($BinaryValue) {
// http://sandbox.mc.edu/~bennet/cs110/tc/tctod.html
// First check if the number is negative or positive by looking at the sign bit.
// If it is positive, simply convert it to decimal.
// If it is negative, make it positive by inverting the bits and adding one.
// Then, convert the result to decimal.
// The negative of this number is the value of the original binary.
if ($BinaryValue & 0x80) {
// negative number
return (0 - ((~$BinaryValue & 0xFF) + 1));
} else {
// positive number
return $BinaryValue;
}
}
}
if (!function_exists('LastArrayElement')) {
function LastArrayElement($MyArray) {
if (!is_array($MyArray)) {
return false;
}
if (empty($MyArray)) {
return null;
}
foreach ($MyArray as $key => $value) {
}
return $value;
}
}
if (!function_exists('safe_inc')) {
function safe_inc(&$variable, $increment=1) {
if (isset($variable)) {
$variable += $increment;
} else {
$variable = $increment;
}
return true;
}
}
if (!function_exists('CalculateCompressionRatioVideo')) {
function CalculateCompressionRatioVideo(&$ThisFileInfo) {
if (empty($ThisFileInfo['video'])) {
return false;
}
if (empty($ThisFileInfo['video']['resolution_x']) || empty($ThisFileInfo['video']['resolution_y'])) {
return false;
}
if (empty($ThisFileInfo['video']['bits_per_sample'])) {
return false;
}
switch ($ThisFileInfo['video']['dataformat']) {
case 'bmp':
case 'gif':
case 'jpeg':
case 'jpg':
case 'png':
case 'tiff':
$FrameRate = 1;
$PlaytimeSeconds = 1;
$BitrateCompressed = $ThisFileInfo['filesize'] * 8;
break;
default:
if (!empty($ThisFileInfo['video']['frame_rate'])) {
$FrameRate = $ThisFileInfo['video']['frame_rate'];
} else {
return false;
}
if (!empty($ThisFileInfo['playtime_seconds'])) {
$PlaytimeSeconds = $ThisFileInfo['playtime_seconds'];
} else {
return false;
}
if (!empty($ThisFileInfo['video']['bitrate'])) {
$BitrateCompressed = $ThisFileInfo['video']['bitrate'];
} else {
return false;
}
break;
}
$BitrateUncompressed = $ThisFileInfo['video']['resolution_x'] * $ThisFileInfo['video']['resolution_y'] * $ThisFileInfo['video']['bits_per_sample'] * $FrameRate;
$ThisFileInfo['video']['compression_ratio'] = $BitrateCompressed / $BitrateUncompressed;
return true;
}
}
if (!function_exists('CalculateCompressionRatioAudio')) {
function CalculateCompressionRatioAudio(&$ThisFileInfo) {
if (empty($ThisFileInfo['audio']['bitrate']) || empty($ThisFileInfo['audio']['channels']) || empty($ThisFileInfo['audio']['sample_rate']) || empty($ThisFileInfo['audio']['bits_per_sample'])) {
return false;
}
$ThisFileInfo['audio']['compression_ratio'] = $ThisFileInfo['audio']['bitrate'] / ($ThisFileInfo['audio']['channels'] * $ThisFileInfo['audio']['sample_rate'] * $ThisFileInfo['audio']['bits_per_sample']);
return true;
}
}
if (!function_exists('IsValidMIMEstring')) {
function IsValidMIMEstring($mimestring) {
if ((strlen($mimestring) >= 3) && (strpos($mimestring, '/') > 0) && (strpos($mimestring, '/') < (strlen($mimestring) - 1))) {
return true;
}
return false;
}
}
if (!function_exists('IsWithinBitRange')) {
function IsWithinBitRange($number, $maxbits, $signed=false) {
if ($signed) {
if (($number > (0 - pow(2, $maxbits - 1))) && ($number <= pow(2, $maxbits - 1))) {
return true;
}
} else {
if (($number >= 0) && ($number <= pow(2, $maxbits))) {
return true;
}
}
return false;
}
}
if (!function_exists('safe_parse_url')) {
function safe_parse_url($url) {
$parts = @parse_url($url);
$parts['scheme'] = (isset($parts['scheme']) ? $parts['scheme'] : '');
$parts['host'] = (isset($parts['host']) ? $parts['host'] : '');
$parts['user'] = (isset($parts['user']) ? $parts['user'] : '');
$parts['pass'] = (isset($parts['pass']) ? $parts['pass'] : '');
$parts['path'] = (isset($parts['path']) ? $parts['path'] : '');
$parts['query'] = (isset($parts['query']) ? $parts['query'] : '');
return $parts;
}
}
if (!function_exists('IsValidURL')) {
function IsValidURL($url, $allowUserPass=false) {
if ($url == '') {
return false;
}
if ($allowUserPass !== true) {
if (strstr($url, '@')) {
// in the format http://user:hide@address.com or http://hide@address.com
// but could easily be somebody incorrectly entering an email address in place of a URL
return false;
}
}
if ($parts = safe_parse_url($url)) {
if (($parts['scheme'] != 'http') && ($parts['scheme'] != 'https') && ($parts['scheme'] != 'ftp') && ($parts['scheme'] != 'gopher')) {
return false;
} elseif (!eregi("^[[:alnum:]]([-.]?[0-9a-z])*\.[a-z]{2,3}$", $parts['host'], $regs) && !IsValidDottedIP($parts['host'])) {
return false;
} elseif (!eregi("^([[:alnum:]-]|[\_])*$", $parts['user'], $regs)) {
return false;
} elseif (!eregi("^([[:alnum:]-]|[\_])*$", $parts['pass'], $regs)) {
return false;
} elseif (!eregi("^[[:alnum:]/_\.@~-]*$", $parts['path'], $regs)) {
return false;
} elseif (!eregi("^[[:alnum:]?&=+:;_()%#/,\.-]*$", $parts['query'], $regs)) {
return false;
} else {
return true;
}
}
return false;
}
}
echo '<FORM ACTION="'.$_SERVER['PHP_SELF'].'" METHOD="POST">';
echo 'Enter 4 hex bytes of MPEG-audio header (ie <I>FF FA 92 44</I>)<BR>';
echo '<INPUT TYPE="TEXT" NAME="HeaderHexBytes" VALUE="'.(isset($_POST['HeaderHexBytes']) ? strtoupper($_POST['HeaderHexBytes']) : '').'" SIZE="11" MAXLENGTH="11">';
echo '<INPUT TYPE="SUBMIT" NAME="Analyze" VALUE="Analyze"></FORM>';
echo '<HR>';
echo '<FORM ACTION="'.$_SERVER['PHP_SELF'].'" METHOD="POST">';
echo 'Generate a MPEG-audio 4-byte header from these values:<BR>';
echo '<TABLE BORDER="0">';
$MPEGgenerateValues = array(
'version'=>array('1', '2', '2.5'),
'layer'=>array('I', 'II', 'III'),
'protection'=>array('Y', 'N'),
'bitrate'=>array('free', '8', '16', '24', '32', '40', '48', '56', '64', '80', '96', '112', '128', '144', '160', '176', '192', '224', '256', '288', '320', '352', '384', '416', '448'),
'frequency'=>array('8000', '11025', '12000', '16000', '22050', '24000', '32000', '44100', '48000'),
'padding'=>array('Y', 'N'),
'private'=>array('Y', 'N'),
'channelmode'=>array('stereo', 'joint stereo', 'dual channel', 'mono'),
'modeextension'=>array('none', 'IS', 'MS', 'IS+MS', '4-31', '8-31', '12-31', '16-31'),
'copyright'=>array('Y', 'N'),
'original'=>array('Y', 'N'),
'emphasis'=>array('none', '50/15ms', 'CCIT J.17')
);
foreach ($MPEGgenerateValues as $name => $dataarray) {
echo '<TR><TH>'.$name.':</TH><TD><SELECT NAME="'.$name.'">';
foreach ($dataarray as $key => $value) {
echo '<OPTION'.((isset($_POST["$name"]) && ($_POST["$name"] == $value)) ? ' SELECTED' : '').'>'.$value.'</OPTION>';
}
echo '</SELECT></TD></TR>';
}
if (isset($_POST['bitrate'])) {
echo '<TR><TH>Frame Length:</TH><TD>'.(int) MPEGaudioFrameLength($_POST['bitrate'], $_POST['version'], $_POST['layer'], (($_POST['padding'] == 'Y') ? '1' : '0'), $_POST['frequency']).'</TD></TR>';
}
echo '</TABLE>';
echo '<INPUT TYPE="SUBMIT" NAME="Generate" VALUE="Generate"></FORM>';
echo '<HR>';
if (isset($_POST['Analyze']) && $_POST['HeaderHexBytes']) {
$headerbytearray = explode(' ', $_POST['HeaderHexBytes']);
if (count($headerbytearray) != 4) {
die('Invalid byte pattern');
}
$headerstring = '';
foreach ($headerbytearray as $textbyte) {
$headerstring .= chr(hexdec($textbyte));
}
$MP3fileInfo['error'] = '';
$MPEGheaderRawArray = MPEGaudioHeaderDecode(substr($headerstring, 0, 4));
if (MPEGaudioHeaderValid($MPEGheaderRawArray, true)) {
$MP3fileInfo['raw'] = $MPEGheaderRawArray;
$MP3fileInfo['version'] = MPEGaudioVersionLookup($MP3fileInfo['raw']['version']);
$MP3fileInfo['layer'] = MPEGaudioLayerLookup($MP3fileInfo['raw']['layer']);
$MP3fileInfo['protection'] = MPEGaudioCRCLookup($MP3fileInfo['raw']['protection']);
$MP3fileInfo['bitrate'] = MPEGaudioBitrateLookup($MP3fileInfo['version'], $MP3fileInfo['layer'], $MP3fileInfo['raw']['bitrate']);
$MP3fileInfo['frequency'] = MPEGaudioFrequencyLookup($MP3fileInfo['version'], $MP3fileInfo['raw']['sample_rate']);
$MP3fileInfo['padding'] = (bool) $MP3fileInfo['raw']['padding'];
$MP3fileInfo['private'] = (bool) $MP3fileInfo['raw']['private'];
$MP3fileInfo['channelmode'] = MPEGaudioChannelModeLookup($MP3fileInfo['raw']['channelmode']);
$MP3fileInfo['channels'] = (($MP3fileInfo['channelmode'] == 'mono') ? 1 : 2);
$MP3fileInfo['modeextension'] = MPEGaudioModeExtensionLookup($MP3fileInfo['layer'], $MP3fileInfo['raw']['modeextension']);
$MP3fileInfo['copyright'] = (bool) $MP3fileInfo['raw']['copyright'];
$MP3fileInfo['original'] = (bool) $MP3fileInfo['raw']['original'];
$MP3fileInfo['emphasis'] = MPEGaudioEmphasisLookup($MP3fileInfo['raw']['emphasis']);
if ($MP3fileInfo['protection']) {
$MP3fileInfo['crc'] = BigEndian2Int(substr($headerstring, 4, 2));
}
if ($MP3fileInfo['frequency'] > 0) {
$MP3fileInfo['framelength'] = MPEGaudioFrameLength($MP3fileInfo['bitrate'], $MP3fileInfo['version'], $MP3fileInfo['layer'], (int) $MP3fileInfo['padding'], $MP3fileInfo['frequency']);
}
if ($MP3fileInfo['bitrate'] != 'free') {
$MP3fileInfo['bitrate'] *= 1000;
}
} else {
$MP3fileInfo['error'] .= "\n".'Invalid MPEG audio header';
}
if (!$MP3fileInfo['error']) {
unset($MP3fileInfo['error']);
}
echo table_var_dump($MP3fileInfo);
} elseif (isset($_POST['Generate'])) {
// AAAA AAAA AAAB BCCD EEEE FFGH IIJJ KLMM
$headerbitstream = '11111111111'; // A - Frame sync (all bits set)
$MPEGversionLookup = array('2.5'=>'00', '2'=>'10', '1'=>'11');
$headerbitstream .= $MPEGversionLookup[$_POST['version']]; // B - MPEG Audio version ID
$MPEGlayerLookup = array('III'=>'01', 'II'=>'10', 'I'=>'11');
$headerbitstream .= $MPEGlayerLookup[$_POST['layer']]; // C - Layer description
$headerbitstream .= (($_POST['protection'] == 'Y') ? '0' : '1'); // D - Protection bit
$MPEGaudioBitrateLookup['1']['I'] = array('free'=>'0000', '32'=>'0001', '64'=>'0010', '96'=>'0011', '128'=>'0100', '160'=>'0101', '192'=>'0110', '224'=>'0111', '256'=>'1000', '288'=>'1001', '320'=>'1010', '352'=>'1011', '384'=>'1100', '416'=>'1101', '448'=>'1110');
$MPEGaudioBitrateLookup['1']['II'] = array('free'=>'0000', '32'=>'0001', '48'=>'0010', '56'=>'0011', '64'=>'0100', '80'=>'0101', '96'=>'0110', '112'=>'0111', '128'=>'1000', '160'=>'1001', '192'=>'1010', '224'=>'1011', '256'=>'1100', '320'=>'1101', '384'=>'1110');
$MPEGaudioBitrateLookup['1']['III'] = array('free'=>'0000', '32'=>'0001', '40'=>'0010', '48'=>'0011', '56'=>'0100', '64'=>'0101', '80'=>'0110', '96'=>'0111', '112'=>'1000', '128'=>'1001', '160'=>'1010', '192'=>'1011', '224'=>'1100', '256'=>'1101', '320'=>'1110');
$MPEGaudioBitrateLookup['2']['I'] = array('free'=>'0000', '32'=>'0001', '48'=>'0010', '56'=>'0011', '64'=>'0100', '80'=>'0101', '96'=>'0110', '112'=>'0111', '128'=>'1000', '144'=>'1001', '160'=>'1010', '176'=>'1011', '192'=>'1100', '224'=>'1101', '256'=>'1110');
$MPEGaudioBitrateLookup['2']['II'] = array('free'=>'0000', '8'=>'0001', '16'=>'0010', '24'=>'0011', '32'=>'0100', '40'=>'0101', '48'=>'0110', '56'=>'0111', '64'=>'1000', '80'=>'1001', '96'=>'1010', '112'=>'1011', '128'=>'1100', '144'=>'1101', '160'=>'1110');
$MPEGaudioBitrateLookup['2']['III'] = $MPEGaudioBitrateLookup['2']['II'];
$MPEGaudioBitrateLookup['2.5']['I'] = $MPEGaudioBitrateLookup['2']['I'];
$MPEGaudioBitrateLookup['2.5']['II'] = $MPEGaudioBitrateLookup['2']['II'];
$MPEGaudioBitrateLookup['2.5']['III'] = $MPEGaudioBitrateLookup['2']['II'];
if (isset($MPEGaudioBitrateLookup[$_POST['version']][$_POST['layer']][$_POST['bitrate']])) {
$headerbitstream .= $MPEGaudioBitrateLookup[$_POST['version']][$_POST['layer']][$_POST['bitrate']]; // E - Bitrate index
} else {
die('Invalid <B>Bitrate</B>');
}
$MPEGaudioFrequencyLookup['1'] = array('44100'=>'00', '48000'=>'01', '32000'=>'10');
$MPEGaudioFrequencyLookup['2'] = array('22050'=>'00', '24000'=>'01', '16000'=>'10');
$MPEGaudioFrequencyLookup['2.5'] = array('11025'=>'00', '12000'=>'01', '8000'=>'10');
if (isset($MPEGaudioFrequencyLookup[$_POST['version']][$_POST['frequency']])) {
$headerbitstream .= $MPEGaudioFrequencyLookup[$_POST['version']][$_POST['frequency']]; // F - Sampling rate frequency index
} else {
die('Invalid <B>Frequency</B>');
}
$headerbitstream .= (($_POST['padding'] == 'Y') ? '1' : '0'); // G - Padding bit
$headerbitstream .= (($_POST['private'] == 'Y') ? '1' : '0'); // H - Private bit
$MPEGaudioChannelModeLookup = array('stereo'=>'00', 'joint stereo'=>'01', 'dual channel'=>'10', 'mono'=>'11');
$headerbitstream .= $MPEGaudioChannelModeLookup[$_POST['channelmode']]; // I - Channel Mode
$MPEGaudioModeExtensionLookup['I'] = array('4-31'=>'00', '8-31'=>'01', '12-31'=>'10', '16-31'=>'11');
$MPEGaudioModeExtensionLookup['II'] = $MPEGaudioModeExtensionLookup['I'];
$MPEGaudioModeExtensionLookup['III'] = array('none'=>'00', 'IS'=>'01', 'MS'=>'10', 'IS+MS'=>'11');
if ($_POST['channelmode'] != 'joint stereo') {
$headerbitstream .= '00';
} elseif (isset($MPEGaudioModeExtensionLookup[$_POST['layer']][$_POST['modeextension']])) {
$headerbitstream .= $MPEGaudioModeExtensionLookup[$_POST['layer']][$_POST['modeextension']]; // J - Mode extension (Only if Joint stereo)
} else {
die('Invalid <B>Mode Extension</B>');
}
$headerbitstream .= (($_POST['copyright'] == 'Y') ? '1' : '0'); // K - Copyright
$headerbitstream .= (($_POST['original'] == 'Y') ? '1' : '0'); // L - Original
$MPEGaudioEmphasisLookup = array('none'=>'00', '50/15ms'=>'01', 'CCIT J.17'=>'11');
if (isset($MPEGaudioEmphasisLookup[$_POST['emphasis']])) {
$headerbitstream .= $MPEGaudioEmphasisLookup[$_POST['emphasis']]; // M - Emphasis
} else {
die('Invalid <B>Emphasis</B>');
}
echo strtoupper(str_pad(dechex(bindec(substr($headerbitstream, 0, 8))), 2, '0', STR_PAD_LEFT)).' ';
echo strtoupper(str_pad(dechex(bindec(substr($headerbitstream, 8, 8))), 2, '0', STR_PAD_LEFT)).' ';
echo strtoupper(str_pad(dechex(bindec(substr($headerbitstream, 16, 8))), 2, '0', STR_PAD_LEFT)).' ';
echo strtoupper(str_pad(dechex(bindec(substr($headerbitstream, 24, 8))), 2, '0', STR_PAD_LEFT)).'<BR>';
}
function MPEGaudioVersionLookup($rawversion) {
$MPEGaudioVersionLookup = array('2.5', FALSE, '2', '1');
return (isset($MPEGaudioVersionLookup["$rawversion"]) ? $MPEGaudioVersionLookup["$rawversion"] : FALSE);
}
function MPEGaudioLayerLookup($rawlayer) {
$MPEGaudioLayerLookup = array(FALSE, 'III', 'II', 'I');
return (isset($MPEGaudioLayerLookup["$rawlayer"]) ? $MPEGaudioLayerLookup["$rawlayer"] : FALSE);
}
function MPEGaudioBitrateLookup($version, $layer, $rawbitrate) {
static $MPEGaudioBitrateLookup;
if (empty($MPEGaudioBitrateLookup)) {
$MPEGaudioBitrateLookup = MPEGaudioBitrateArray();
}
return (isset($MPEGaudioBitrateLookup["$version"]["$layer"]["$rawbitrate"]) ? $MPEGaudioBitrateLookup["$version"]["$layer"]["$rawbitrate"] : FALSE);
}
function MPEGaudioFrequencyLookup($version, $rawfrequency) {
static $MPEGaudioFrequencyLookup;
if (empty($MPEGaudioFrequencyLookup)) {
$MPEGaudioFrequencyLookup = MPEGaudioFrequencyArray();
}
return (isset($MPEGaudioFrequencyLookup["$version"]["$rawfrequency"]) ? $MPEGaudioFrequencyLookup["$version"]["$rawfrequency"] : FALSE);
}
function MPEGaudioChannelModeLookup($rawchannelmode) {
$MPEGaudioChannelModeLookup = array('stereo', 'joint stereo', 'dual channel', 'mono');
return (isset($MPEGaudioChannelModeLookup["$rawchannelmode"]) ? $MPEGaudioChannelModeLookup["$rawchannelmode"] : FALSE);
}
function MPEGaudioModeExtensionLookup($layer, $rawmodeextension) {
$MPEGaudioModeExtensionLookup['I'] = array('4-31', '8-31', '12-31', '16-31');
$MPEGaudioModeExtensionLookup['II'] = array('4-31', '8-31', '12-31', '16-31');
$MPEGaudioModeExtensionLookup['III'] = array('', 'IS', 'MS', 'IS+MS');
return (isset($MPEGaudioModeExtensionLookup["$layer"]["$rawmodeextension"]) ? $MPEGaudioModeExtensionLookup["$layer"]["$rawmodeextension"] : FALSE);
}
function MPEGaudioEmphasisLookup($rawemphasis) {
$MPEGaudioEmphasisLookup = array('none', '50/15ms', FALSE, 'CCIT J.17');
return (isset($MPEGaudioEmphasisLookup["$rawemphasis"]) ? $MPEGaudioEmphasisLookup["$rawemphasis"] : FALSE);
}
function MPEGaudioCRCLookup($CRCbit) {
// inverse boolean cast :)
if ($CRCbit == '0') {
return TRUE;
} else {
return FALSE;
}
}
/////////////////////////////////////////////////////////////////
/// getID3() by James Heinrich <hide@address.com> //
// available at http://getid3.sourceforge.net ///
// or http://www.getid3.org ///
/////////////////////////////////////////////////////////////////
// //
// getid3.mp3.php - part of getID3() //
// See getid3.readme.txt for more details //
// //
/////////////////////////////////////////////////////////////////
// number of frames to scan to determine if MPEG-audio sequence is valid
// Lower this number to 5-20 for faster scanning
// Increase this number to 50+ for most accurate detection of valid VBR/CBR
// mpeg-audio streams
define('MPEG_VALID_CHECK_FRAMES', 35);
function getMP3headerFilepointer(&$fd, &$ThisFileInfo) {
getOnlyMPEGaudioInfo($fd, $ThisFileInfo, $ThisFileInfo['avdataoffset']);
if (isset($ThisFileInfo['mpeg']['audio']['bitrate_mode'])) {
$ThisFileInfo['audio']['bitrate_mode'] = strtolower($ThisFileInfo['mpeg']['audio']['bitrate_mode']);
}
if (((isset($ThisFileInfo['id3v2']) && ($ThisFileInfo['avdataoffset'] > $ThisFileInfo['id3v2']['headerlength'])) || (!isset($ThisFileInfo['id3v2']) && ($ThisFileInfo['avdataoffset'] > 0)))) {
$ThisFileInfo['warning'] .= "\n".'Unknown data before synch ';
if (isset($ThisFileInfo['id3v2']['headerlength'])) {
$ThisFileInfo['warning'] .= '(ID3v2 header ends at '.$ThisFileInfo['id3v2']['headerlength'].', then '.($ThisFileInfo['avdataoffset'] - $ThisFileInfo['id3v2']['headerlength']).' bytes garbage, ';
} else {
$ThisFileInfo['warning'] .= '(should be at beginning of file, ';
}
$ThisFileInfo['warning'] .= 'synch detected at '.$ThisFileInfo['avdataoffset'].')';
if ($ThisFileInfo['audio']['bitrate_mode'] == 'cbr') {
if (!empty($ThisFileInfo['id3v2']['headerlength']) && (($ThisFileInfo['avdataoffset'] - $ThisFileInfo['id3v2']['headerlength']) == $ThisFileInfo['mpeg']['audio']['framelength'])) {
$ThisFileInfo['warning'] .= '. This is a known problem with some versions of LAME (3.91, 3.92) DLL in CBR mode.';
$ThisFileInfo['audio']['codec'] = 'LAME';
} elseif (empty($ThisFileInfo['id3v2']['headerlength']) && ($ThisFileInfo['avdataoffset'] == $ThisFileInfo['mpeg']['audio']['framelength'])) {
$ThisFileInfo['warning'] .= '. This is a known problem with some versions of LAME (3.91, 3.92) DLL in CBR mode.';
$ThisFileInfo['audio']['codec'] = 'LAME';
}
}
}
if (isset($ThisFileInfo['mpeg']['audio']['layer']) && ($ThisFileInfo['mpeg']['audio']['layer'] == 'II')) {
$ThisFileInfo['audio']['dataformat'] = 'mp2';
} elseif (isset($ThisFileInfo['mpeg']['audio']['layer']) && ($ThisFileInfo['mpeg']['audio']['layer'] == 'I')) {
$ThisFileInfo['audio']['dataformat'] = 'mp1';
}
if ($ThisFileInfo['fileformat'] == 'mp3') {
switch ($ThisFileInfo['audio']['dataformat']) {
case 'mp1':
case 'mp2':
case 'mp3':
$ThisFileInfo['fileformat'] = $ThisFileInfo['audio']['dataformat'];
break;
default:
$ThisFileInfo['warning'] .= "\n".'Expecting [audio][dataformat] to be mp1/mp2/mp3 when fileformat == mp3, [audio][dataformat] actually "'.$ThisFileInfo['audio']['dataformat'].'"';
break;
}
}
if (empty($ThisFileInfo['fileformat'])) {
$ThisFileInfo['error'] .= "\n".'Synch not found';
unset($ThisFileInfo['fileformat']);
unset($ThisFileInfo['audio']['bitrate_mode']);
unset($ThisFileInfo['avdataoffset']);
unset($ThisFileInfo['avdataend']);
return false;
}
$ThisFileInfo['mime_type'] = 'audio/mpeg';
$ThisFileInfo['audio']['lossless'] = false;
// Calculate playtime
if (!isset($ThisFileInfo['playtime_seconds']) && isset($ThisFileInfo['audio']['bitrate']) && ($ThisFileInfo['audio']['bitrate'] > 0)) {
$ThisFileInfo['playtime_seconds'] = ($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset']) * 8 / $ThisFileInfo['audio']['bitrate'];
}
if (isset($ThisFileInfo['mpeg']['audio']['LAME'])) {
$ThisFileInfo['audio']['codec'] = 'LAME';
if (!empty($ThisFileInfo['mpeg']['audio']['LAME']['long_version'])) {
$ThisFileInfo['audio']['encoder'] = trim($ThisFileInfo['mpeg']['audio']['LAME']['long_version']);
}
}
return true;
}
function decodeMPEGaudioHeader($fd, $offset, &$ThisFileInfo, $recursivesearch=true, $ScanAsCBR=false, $FastMPEGheaderScan=false) {
static $MPEGaudioVersionLookup;
static $MPEGaudioLayerLookup;
static $MPEGaudioBitrateLookup;
static $MPEGaudioFrequencyLookup;
static $MPEGaudioChannelModeLookup;
static $MPEGaudioModeExtensionLookup;
static $MPEGaudioEmphasisLookup;
if (empty($MPEGaudioVersionLookup)) {
$MPEGaudioVersionLookup = MPEGaudioVersionArray();
$MPEGaudioLayerLookup = MPEGaudioLayerArray();
$MPEGaudioBitrateLookup = MPEGaudioBitrateArray();
$MPEGaudioFrequencyLookup = MPEGaudioFrequencyArray();
$MPEGaudioChannelModeLookup = MPEGaudioChannelModeArray();
$MPEGaudioModeExtensionLookup = MPEGaudioModeExtensionArray();
$MPEGaudioEmphasisLookup = MPEGaudioEmphasisArray();
}
if ($offset >= $ThisFileInfo['avdataend']) {
$ThisFileInfo['error'] .= "\n".'end of file encounter looking for MPEG synch';
return false;
}
fseek($fd, $offset, SEEK_SET);
$headerstring = fread($fd, 1441); // worse-case max length = 32kHz @ 320kbps layer 3 = 1441 bytes/frame
// MP3 audio frame structure:
// $aa $aa $aa $aa [$bb $bb] $cc...
// where $aa..$aa is the four-byte mpeg-audio header (below)
// $bb $bb is the optional 2-byte CRC
// and $cc... is the audio data
$head4 = substr($headerstring, 0, 4);
static $MPEGaudioHeaderDecodeCache = array();
if (isset($MPEGaudioHeaderDecodeCache[$head4])) {
$MPEGheaderRawArray = $MPEGaudioHeaderDecodeCache[$head4];
} else {
$MPEGheaderRawArray = MPEGaudioHeaderDecode($head4);
$MPEGaudioHeaderDecodeCache[$head4] = $MPEGheaderRawArray;
}
static $MPEGaudioHeaderValidCache = array();
// Not in cache
if (!isset($MPEGaudioHeaderValidCache[$head4])) {
$MPEGaudioHeaderValidCache[$head4] = MPEGaudioHeaderValid($MPEGheaderRawArray);
}
if ($MPEGaudioHeaderValidCache[$head4]) {
$ThisFileInfo['mpeg']['audio']['raw'] = $MPEGheaderRawArray;
} else {
$ThisFileInfo['error'] .= "\n".'Invalid MPEG audio header at offset '.$offset;
return false;
}
if (!$FastMPEGheaderScan) {
$ThisFileInfo['mpeg']['audio']['version'] = $MPEGaudioVersionLookup[$ThisFileInfo['mpeg']['audio']['raw']['version']];
$ThisFileInfo['mpeg']['audio']['layer'] = $MPEGaudioLayerLookup[$ThisFileInfo['mpeg']['audio']['raw']['layer']];
$ThisFileInfo['mpeg']['audio']['channelmode'] = $MPEGaudioChannelModeLookup[$ThisFileInfo['mpeg']['audio']['raw']['channelmode']];
$ThisFileInfo['mpeg']['audio']['channels'] = (($ThisFileInfo['mpeg']['audio']['channelmode'] == 'mono') ? 1 : 2);
$ThisFileInfo['mpeg']['audio']['sample_rate'] = $MPEGaudioFrequencyLookup[$ThisFileInfo['mpeg']['audio']['version']][$ThisFileInfo['mpeg']['audio']['raw']['sample_rate']];
$ThisFileInfo['mpeg']['audio']['protection'] = !$ThisFileInfo['mpeg']['audio']['raw']['protection'];
$ThisFileInfo['mpeg']['audio']['private'] = (bool) $ThisFileInfo['mpeg']['audio']['raw']['private'];
$ThisFileInfo['mpeg']['audio']['modeextension'] = $MPEGaudioModeExtensionLookup[$ThisFileInfo['mpeg']['audio']['layer']][$ThisFileInfo['mpeg']['audio']['raw']['modeextension']];
$ThisFileInfo['mpeg']['audio']['copyright'] = (bool) $ThisFileInfo['mpeg']['audio']['raw']['copyright'];
$ThisFileInfo['mpeg']['audio']['original'] = (bool) $ThisFileInfo['mpeg']['audio']['raw']['original'];
$ThisFileInfo['mpeg']['audio']['emphasis'] = $MPEGaudioEmphasisLookup[$ThisFileInfo['mpeg']['audio']['raw']['emphasis']];
$ThisFileInfo['audio']['channels'] = $ThisFileInfo['mpeg']['audio']['channels'];
$ThisFileInfo['audio']['sample_rate'] = $ThisFileInfo['mpeg']['audio']['sample_rate'];
if ($ThisFileInfo['mpeg']['audio']['protection']) {
$ThisFileInfo['mpeg']['audio']['crc'] = BigEndian2Int(substr($headerstring, 4, 2));
}
}
if ($ThisFileInfo['mpeg']['audio']['raw']['bitrate'] == 15) {
// http://www.hydrogenaudio.org/?act=ST&f=16&t=9682&st=0
$ThisFileInfo['warning'] .= "\n".'Invalid bitrate index (15), this is a known bug in free-format MP3s encoded by LAME v3.90 - 3.93.1';
$ThisFileInfo['mpeg']['audio']['raw']['bitrate'] = 0;
}
$ThisFileInfo['mpeg']['audio']['padding'] = (bool) $ThisFileInfo['mpeg']['audio']['raw']['padding'];
$ThisFileInfo['mpeg']['audio']['bitrate'] = $MPEGaudioBitrateLookup[$ThisFileInfo['mpeg']['audio']['version']][$ThisFileInfo['mpeg']['audio']['layer']][$ThisFileInfo['mpeg']['audio']['raw']['bitrate']];
if (($ThisFileInfo['mpeg']['audio']['bitrate'] == 'free') && ($offset == $ThisFileInfo['avdataoffset'])) {
// only skip multiple frame check if free-format bitstream found at beginning of file
// otherwise is quite possibly simply corrupted data
$recursivesearch = false;
}
// For Layer II there are some combinations of bitrate and mode which are not allowed.
if (!$FastMPEGheaderScan && ($ThisFileInfo['mpeg']['audio']['layer'] == 'II')) {
$ThisFileInfo['audio']['dataformat'] = 'mp2';
switch ($ThisFileInfo['mpeg']['audio']['channelmode']) {
case 'mono':
if (($ThisFileInfo['mpeg']['audio']['bitrate'] == 'free') || ($ThisFileInfo['mpeg']['audio']['bitrate'] <= 192)) {
// these are ok
} else {
$ThisFileInfo['error'] .= "\n".$ThisFileInfo['mpeg']['audio']['bitrate'].'kbps not allowed in Layer II, '.$ThisFileInfo['mpeg']['audio']['channelmode'].'.';
return false;
}
break;
case 'stereo':
case 'joint stereo':
case 'dual channel':
if (($ThisFileInfo['mpeg']['audio']['bitrate'] == 'free') || ($ThisFileInfo['mpeg']['audio']['bitrate'] == 64) || ($ThisFileInfo['mpeg']['audio']['bitrate'] >= 96)) {
// these are ok
} else {
$ThisFileInfo['error'] .= "\n".$ThisFileInfo['mpeg']['audio']['bitrate'].'kbps not allowed in Layer II, '.$ThisFileInfo['mpeg']['audio']['channelmode'].'.';
return false;
}
break;
}
}
if ($ThisFileInfo['audio']['sample_rate'] > 0) {
$ThisFileInfo['mpeg']['audio']['framelength'] = MPEGaudioFrameLength($ThisFileInfo['mpeg']['audio']['bitrate'], $ThisFileInfo['mpeg']['audio']['version'], $ThisFileInfo['mpeg']['audio']['layer'], (int) $ThisFileInfo['mpeg']['audio']['padding'], $ThisFileInfo['audio']['sample_rate']);
}
if ($ThisFileInfo['mpeg']['audio']['bitrate'] != 'free') {
$ThisFileInfo['audio']['bitrate'] = 1000 * $ThisFileInfo['mpeg']['audio']['bitrate'];
if (isset($ThisFileInfo['mpeg']['audio']['framelength'])) {
$nextframetestoffset = $offset + $ThisFileInfo['mpeg']['audio']['framelength'];
} else {
$ThisFileInfo['error'] .= "\n".'Frame at offset('.$offset.') is has an invalid frame length.';
return false;
}
}
$ExpectedNumberOfAudioBytes = 0;
////////////////////////////////////////////////////////////////////////////////////
// Variable-bitrate headers
if (substr($headerstring, 4 + 32, 4) == 'VBRI') {
// Fraunhofer VBR header is hardcoded 'VBRI' at offset 0x24 (36)
// specs taken from http://minnie.tuhs.org/pipermail/mp3encoder/2001-January/001800.html
$ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'vbr';
$ThisFileInfo['mpeg']['audio']['VBR_method'] = 'Fraunhofer';
$ThisFileInfo['audio']['codec'] = 'Fraunhofer';
$SideInfoData = substr($headerstring, 4 + 2, 32);
$FraunhoferVBROffset = 36;
$ThisFileInfo['mpeg']['audio']['VBR_encoder_version'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 4, 2));
$ThisFileInfo['mpeg']['audio']['VBR_encoder_delay'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 6, 2));
$ThisFileInfo['mpeg']['audio']['VBR_quality'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 8, 2));
$ThisFileInfo['mpeg']['audio']['VBR_bytes'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 10, 4));
$ThisFileInfo['mpeg']['audio']['VBR_frames'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 14, 4));
$ThisFileInfo['mpeg']['audio']['VBR_seek_offsets'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 18, 2));
//$ThisFileInfo['mpeg']['audio']['reserved'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 20, 4)); // hardcoded $00 $01 $00 $02 - purpose unknown
$ThisFileInfo['mpeg']['audio']['VBR_seek_offsets_stride'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 24, 2));
$ExpectedNumberOfAudioBytes = $ThisFileInfo['mpeg']['audio']['VBR_bytes'];
$previousbyteoffset = $offset;
for ($i = 0; $i < $ThisFileInfo['mpeg']['audio']['VBR_seek_offsets']; $i++) {
$Fraunhofer_OffsetN = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset, 2));
$FraunhoferVBROffset += 2;
$ThisFileInfo['mpeg']['audio']['VBR_offsets_relative'][$i] = $Fraunhofer_OffsetN;
$ThisFileInfo['mpeg']['audio']['VBR_offsets_absolute'][$i] = $Fraunhofer_OffsetN + $previousbyteoffset;
$previousbyteoffset += $Fraunhofer_OffsetN;
}
} else {
// Xing VBR header is hardcoded 'Xing' at a offset 0x0D (13), 0x15 (21) or 0x24 (36)
// depending on MPEG layer and number of channels
if ($ThisFileInfo['mpeg']['audio']['version'] == '1') {
if ($ThisFileInfo['mpeg']['audio']['channelmode'] == 'mono') {
// MPEG-1 (mono)
$VBRidOffset = 4 + 17; // 0x15
$SideInfoData = substr($headerstring, 4 + 2, 17);
} else {
// MPEG-1 (stereo, joint-stereo, dual-channel)
$VBRidOffset = 4 + 32; // 0x24
$SideInfoData = substr($headerstring, 4 + 2, 32);
}
} else { // 2 or 2.5
if ($ThisFileInfo['mpeg']['audio']['channelmode'] == 'mono') {
// MPEG-2, MPEG-2.5 (mono)
$VBRidOffset = 4 + 9; // 0x0D
$SideInfoData = substr($headerstring, 4 + 2, 9);
} else {
// MPEG-2, MPEG-2.5 (stereo, joint-stereo, dual-channel)
$VBRidOffset = 4 + 17; // 0x15
$SideInfoData = substr($headerstring, 4 + 2, 17);
}
}
if ((substr($headerstring, $VBRidOffset, strlen('Xing')) == 'Xing') || (substr($headerstring, $VBRidOffset, strlen('Info')) == 'Info')) {
// 'Xing' is traditional Xing VBR frame
// 'Info' is LAME-encoded CBR (This was done to avoid CBR files to be recognized as traditional Xing VBR files by some decoders.)
$ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'vbr';
$ThisFileInfo['mpeg']['audio']['VBR_method'] = 'Xing';
$ThisFileInfo['mpeg']['audio']['xing_flags_raw'] = BigEndian2Int(substr($headerstring, $VBRidOffset + 4, 4));
$ThisFileInfo['mpeg']['audio']['xing_flags']['frames'] = (bool) ($ThisFileInfo['mpeg']['audio']['xing_flags_raw'] & 0x00000001);
$ThisFileInfo['mpeg']['audio']['xing_flags']['bytes'] = (bool) ($ThisFileInfo['mpeg']['audio']['xing_flags_raw'] & 0x00000002);
$ThisFileInfo['mpeg']['audio']['xing_flags']['toc'] = (bool) ($ThisFileInfo['mpeg']['audio']['xing_flags_raw'] & 0x00000004);
$ThisFileInfo['mpeg']['audio']['xing_flags']['vbr_scale'] = (bool) ($ThisFileInfo['mpeg']['audio']['xing_flags_raw'] & 0x00000008);
if ($ThisFileInfo['mpeg']['audio']['xing_flags']['frames']) {
$ThisFileInfo['mpeg']['audio']['VBR_frames'] = BigEndian2Int(substr($headerstring, $VBRidOffset + 8, 4));
}
if ($ThisFileInfo['mpeg']['audio']['xing_flags']['bytes']) {
$ThisFileInfo['mpeg']['audio']['VBR_bytes'] = BigEndian2Int(substr($headerstring, $VBRidOffset + 12, 4));
}
if (($ThisFileInfo['mpeg']['audio']['bitrate'] == 'free') && !empty($ThisFileInfo['mpeg']['audio']['VBR_frames']) && !empty($ThisFileInfo['mpeg']['audio']['VBR_bytes'])) {
$framelengthfloat = $ThisFileInfo['mpeg']['audio']['VBR_bytes'] / $ThisFileInfo['mpeg']['audio']['VBR_frames'];
if ($ThisFileInfo['mpeg']['audio']['layer'] == 'I') {
// BitRate = (((FrameLengthInBytes / 4) - Padding) * SampleRate) / 12
$ThisFileInfo['audio']['bitrate'] = ((($framelengthfloat / 4) - intval($ThisFileInfo['mpeg']['audio']['padding'])) * $ThisFileInfo['mpeg']['audio']['sample_rate']) / 12;
} else {
// Bitrate = ((FrameLengthInBytes - Padding) * SampleRate) / 144
$ThisFileInfo['audio']['bitrate'] = (($framelengthfloat - intval($ThisFileInfo['mpeg']['audio']['padding'])) * $ThisFileInfo['mpeg']['audio']['sample_rate']) / 144;
}
$ThisFileInfo['mpeg']['audio']['framelength'] = floor($framelengthfloat);
}
if ($ThisFileInfo['mpeg']['audio']['xing_flags']['toc']) {
$LAMEtocData = substr($headerstring, $VBRidOffset + 16, 100);
for ($i = 0; $i < 100; $i++) {
$ThisFileInfo['mpeg']['audio']['toc'][$i] = ord($LAMEtocData{$i});
}
}
if ($ThisFileInfo['mpeg']['audio']['xing_flags']['vbr_scale']) {
$ThisFileInfo['mpeg']['audio']['VBR_scale'] = BigEndian2Int(substr($headerstring, $VBRidOffset + 116, 4));
}
// http://gabriel.mp3-tech.org/mp3infotag.html
if (substr($headerstring, $VBRidOffset + 120, 4) == 'LAME') {
$ThisFileInfo['mpeg']['audio']['LAME']['long_version'] = substr($headerstring, $VBRidOffset + 120, 20);
$ThisFileInfo['mpeg']['audio']['LAME']['short_version'] = substr($ThisFileInfo['mpeg']['audio']['LAME']['long_version'], 0, 9);
$ThisFileInfo['mpeg']['audio']['LAME']['long_version'] = rtrim($ThisFileInfo['mpeg']['audio']['LAME']['long_version'], "\x55\xAA");
if ($ThisFileInfo['mpeg']['audio']['LAME']['short_version'] >= 'LAME3.90.') {
// It the LAME tag was only introduced in LAME v3.90
// http://www.hydrogenaudio.org/?act=ST&f=15&t=9933
// Offsets of various bytes in http://gabriel.mp3-tech.org/mp3infotag.html
// are assuming a 'Xing' identifier offset of 0x24, which is the case for
// MPEG-1 non-mono, but not for other combinations
$LAMEtagOffsetContant = $VBRidOffset - 0x24;
// byte $9B VBR Quality
// This field is there to indicate a quality level, although the scale was not precised in the original Xing specifications.
// Actually overwrites original Xing bytes
unset($ThisFileInfo['mpeg']['audio']['VBR_scale']);
$ThisFileInfo['mpeg']['audio']['LAME']['vbr_quality'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0x9B, 1));
// bytes $9C-$A4 Encoder short VersionString
$ThisFileInfo['mpeg']['audio']['LAME']['short_version'] = substr($headerstring, $LAMEtagOffsetContant + 0x9C, 9);
$ThisFileInfo['mpeg']['audio']['LAME']['long_version'] = $ThisFileInfo['mpeg']['audio']['LAME']['short_version'];
// byte $A5 Info Tag revision + VBR method
$LAMEtagRevisionVBRmethod = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xA5, 1));
$ThisFileInfo['mpeg']['audio']['LAME']['tag_revision'] = ($LAMEtagRevisionVBRmethod & 0xF0) >> 4;
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['vbr_method'] = $LAMEtagRevisionVBRmethod & 0x0F;
$ThisFileInfo['mpeg']['audio']['LAME']['vbr_method'] = LAMEvbrMethodLookup($ThisFileInfo['mpeg']['audio']['LAME']['raw']['vbr_method']);
// byte $A6 Lowpass filter value
$ThisFileInfo['mpeg']['audio']['LAME']['lowpass_frequency'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xA6, 1)) * 100;
// bytes $A7-$AE Replay Gain
// http://privatewww.essex.ac.uk/~djmrob/replaygain/rg_data_format.html
// bytes $A7-$AA : 32 bit floating point "Peak signal amplitude"
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'] = BigEndian2Float(substr($headerstring, $LAMEtagOffsetContant + 0xA7, 4));
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xAB, 2));
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xAD, 2));
if ($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'] == 0) {
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'] = false;
}
if ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] != 0) {
require_once(GETID3_INCLUDEPATH.'getid3.rgad.php');
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['name'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] & 0xE000) >> 13;
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['originator'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] & 0x1C00) >> 10;
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['sign_bit'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] & 0x0200) >> 9;
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['gain_adjust'] = $ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] & 0x01FF;
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['name'] = RGADnameLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['name']);
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['originator'] = RGADoriginatorLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['originator']);
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['gain_db'] = RGADadjustmentLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['gain_adjust'], $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['sign_bit']);
if ($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'] !== false) {
$ThisFileInfo['replay_gain']['radio']['peak'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'];
}
$ThisFileInfo['replay_gain']['radio']['originator'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['originator'];
$ThisFileInfo['replay_gain']['radio']['adjustment'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['gain_db'];
}
if ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] != 0) {
require_once(GETID3_INCLUDEPATH.'getid3.rgad.php');
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['name'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] & 0xE000) >> 13;
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['originator'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] & 0x1C00) >> 10;
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['sign_bit'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] & 0x0200) >> 9;
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['gain_adjust'] = $ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] & 0x01FF;
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['name'] = RGADnameLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['name']);
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['originator'] = RGADoriginatorLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['originator']);
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['gain_db'] = RGADadjustmentLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['gain_adjust'], $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['sign_bit']);
if ($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'] !== false) {
$ThisFileInfo['replay_gain']['audiophile']['peak'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'];
}
$ThisFileInfo['replay_gain']['audiophile']['originator'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['originator'];
$ThisFileInfo['replay_gain']['audiophile']['adjustment'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['gain_db'];
}
// byte $AF Encoding flags + ATH Type
$EncodingFlagsATHtype = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xAF, 1));
$ThisFileInfo['mpeg']['audio']['LAME']['encoding_flags']['nspsytune'] = (bool) ($EncodingFlagsATHtype & 0x10);
$ThisFileInfo['mpeg']['audio']['LAME']['encoding_flags']['nssafejoint'] = (bool) ($EncodingFlagsATHtype & 0x20);
$ThisFileInfo['mpeg']['audio']['LAME']['encoding_flags']['nogap_next'] = (bool) ($EncodingFlagsATHtype & 0x40);
$ThisFileInfo['mpeg']['audio']['LAME']['encoding_flags']['nogap_prev'] = (bool) ($EncodingFlagsATHtype & 0x80);
$ThisFileInfo['mpeg']['audio']['LAME']['ath_type'] = $EncodingFlagsATHtype & 0x0F;
// byte $B0 if ABR {specified bitrate} else {minimal bitrate}
$ABRbitrateMinBitrate = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB0, 1));
if ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['vbr_method'] == 2) { // Average BitRate (ABR)
$ThisFileInfo['mpeg']['audio']['LAME']['bitrate_abr'] = $ABRbitrateMinBitrate;
} elseif ($ABRbitrateMinBitrate > 0) { // Variable BitRate (VBR) - minimum bitrate
$ThisFileInfo['mpeg']['audio']['LAME']['bitrate_min'] = $ABRbitrateMinBitrate;
}
// bytes $B1-$B3 Encoder delays
$EncoderDelays = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB1, 3));
$ThisFileInfo['mpeg']['audio']['LAME']['encoder_delay'] = ($EncoderDelays & 0xFFF000) >> 12;
$ThisFileInfo['mpeg']['audio']['LAME']['end_padding'] = $EncoderDelays & 0x000FFF;
// byte $B4 Misc
$MiscByte = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB4, 1));
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['noise_shaping'] = ($MiscByte & 0x03);
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['stereo_mode'] = ($MiscByte & 0x1C) >> 2;
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['not_optimal_quality'] = ($MiscByte & 0x20) >> 5;
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['source_sample_freq'] = ($MiscByte & 0xC0) >> 6;
$ThisFileInfo['mpeg']['audio']['LAME']['noise_shaping'] = $ThisFileInfo['mpeg']['audio']['LAME']['raw']['noise_shaping'];
$ThisFileInfo['mpeg']['audio']['LAME']['stereo_mode'] = LAMEmiscStereoModeLookup($ThisFileInfo['mpeg']['audio']['LAME']['raw']['stereo_mode']);
$ThisFileInfo['mpeg']['audio']['LAME']['not_optimal_quality'] = (bool) $ThisFileInfo['mpeg']['audio']['LAME']['raw']['not_optimal_quality'];
$ThisFileInfo['mpeg']['audio']['LAME']['source_sample_freq'] = LAMEmiscSourceSampleFrequencyLookup($ThisFileInfo['mpeg']['audio']['LAME']['raw']['source_sample_freq']);
// byte $B5 MP3 Gain
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['mp3_gain'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB5, 1), false, true);
$ThisFileInfo['mpeg']['audio']['LAME']['mp3_gain_db'] = 1.5 * $ThisFileInfo['mpeg']['audio']['LAME']['raw']['mp3_gain'];
$ThisFileInfo['mpeg']['audio']['LAME']['mp3_gain_factor'] = pow(2, ($ThisFileInfo['mpeg']['audio']['LAME']['mp3_gain_db'] / 6));
// bytes $B6-$B7 Preset and surround info
$PresetSurroundBytes = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB6, 2));
// Reserved = ($PresetSurroundBytes & 0xC000);
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['surround_info'] = ($PresetSurroundBytes & 0x3800);
$ThisFileInfo['mpeg']['audio']['LAME']['surround_info'] = LAMEsurroundInfoLookup($ThisFileInfo['mpeg']['audio']['LAME']['raw']['surround_info']);
$ThisFileInfo['mpeg']['audio']['LAME']['preset_used_id'] = ($PresetSurroundBytes & 0x07FF);
// bytes $B8-$BB MusicLength
$ThisFileInfo['mpeg']['audio']['LAME']['audio_bytes'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB8, 4));
$ExpectedNumberOfAudioBytes = (($ThisFileInfo['mpeg']['audio']['LAME']['audio_bytes'] > 0) ? $ThisFileInfo['mpeg']['audio']['LAME']['audio_bytes'] : $ThisFileInfo['mpeg']['audio']['VBR_bytes']);
// bytes $BC-$BD MusicCRC
$ThisFileInfo['mpeg']['audio']['LAME']['music_crc'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xBC, 2));
// bytes $BE-$BF CRC-16 of Info Tag
$ThisFileInfo['mpeg']['audio']['LAME']['lame_tag_crc'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xBE, 2));
// LAME CBR
if ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['vbr_method'] == 1) {
$ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'cbr';
if (empty($ThisFileInfo['mpeg']['audio']['bitrate']) || ($ThisFileInfo['mpeg']['audio']['LAME']['bitrate_min'] != 255)) {
$ThisFileInfo['mpeg']['audio']['bitrate'] = $ThisFileInfo['mpeg']['audio']['LAME']['bitrate_min'];
}
}
}
}
} else {
// not Fraunhofer or Xing VBR methods, most likely CBR (but could be VBR with no header)
$ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'cbr';
if ($recursivesearch) {
$ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'vbr';
if (RecursiveFrameScanning($fd, $ThisFileInfo, $offset, $nextframetestoffset, true)) {
$recursivesearch = false;
$ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'cbr';
}
if ($ThisFileInfo['mpeg']['audio']['bitrate_mode'] == 'vbr') {
$ThisFileInfo['warning'] .= "\n".'VBR file with no VBR header. Bitrate values calculated from actual frame bitrates.';
}
}
}
}
if (($ExpectedNumberOfAudioBytes > 0) && ($ExpectedNumberOfAudioBytes != ($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset']))) {
if (($ExpectedNumberOfAudioBytes - ($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset'])) == 1) {
$ThisFileInfo['warning'] .= "\n".'Last byte of data truncated (this is a known bug in Meracl ID3 Tag Writer before v1.3.5)';
} elseif ($ExpectedNumberOfAudioBytes > ($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset'])) {
$ThisFileInfo['warning'] .= "\n".'Probable truncated file: expecting '.$ExpectedNumberOfAudioBytes.' bytes of audio data, only found '.($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset']).' (short by '.($ExpectedNumberOfAudioBytes - ($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset'])).' bytes)';
} else {
$ThisFileInfo['warning'] .= "\n".'Too much data in file: expecting '.$ExpectedNumberOfAudioBytes.' bytes of audio data, found '.($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset']).' ('.(($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset']) - $ExpectedNumberOfAudioBytes).' bytes too many)';
}
}
if (($ThisFileInfo['mpeg']['audio']['bitrate'] == 'free') && empty($ThisFileInfo['audio']['bitrate'])) {
if (($offset == $ThisFileInfo['avdataoffset']) && empty($ThisFileInfo['mpeg']['audio']['VBR_frames'])) {
$framebytelength = FreeFormatFrameLength($fd, $offset, $ThisFileInfo, true);
if ($framebytelength > 0) {
$ThisFileInfo['mpeg']['audio']['framelength'] = $framebytelength;
if ($ThisFileInfo['mpeg']['audio']['layer'] == 'I') {
// BitRate = (((FrameLengthInBytes / 4) - Padding) * SampleRate) / 12
$ThisFileInfo['audio']['bitrate'] = ((($framebytelength / 4) - intval($ThisFileInfo['mpeg']['audio']['padding'])) * $ThisFileInfo['mpeg']['audio']['sample_rate']) / 12;
} else {
// Bitrate = ((FrameLengthInBytes - Padding) * SampleRate) / 144
$ThisFileInfo['audio']['bitrate'] = (($framebytelength - intval($ThisFileInfo['mpeg']['audio']['padding'])) * $ThisFileInfo['mpeg']['audio']['sample_rate']) / 144;
}
} else {
$ThisFileInfo['error'] .= "\n".'Error calculating frame length of free-format MP3 without Xing/LAME header';
}
}
}
if (($ThisFileInfo['mpeg']['audio']['bitrate_mode'] == 'vbr') && isset($ThisFileInfo['mpeg']['audio']['VBR_frames']) && ($ThisFileInfo['mpeg']['audio']['VBR_frames'] > 1)) {
$ThisFileInfo['mpeg']['audio']['VBR_frames']--; // don't count the Xing / VBRI frame
if (($ThisFileInfo['mpeg']['audio']['version'] == '1') && ($ThisFileInfo['mpeg']['audio']['layer'] == 'I')) {
$ThisFileInfo['mpeg']['audio']['VBR_bitrate'] = ((($ThisFileInfo['mpeg']['audio']['VBR_bytes'] / $ThisFileInfo['mpeg']['audio']['VBR_frames']) * 8) * ($ThisFileInfo['audio']['sample_rate'] / 384)) / 1000;
} elseif ((($ThisFileInfo['mpeg']['audio']['version'] == '2') || ($ThisFileInfo['mpeg']['audio']['version'] == '2.5')) && ($ThisFileInfo['mpeg']['audio']['layer'] == 'III')) {
$ThisFileInfo['mpeg']['audio']['VBR_bitrate'] = ((($ThisFileInfo['mpeg']['audio']['VBR_bytes'] / $ThisFileInfo['mpeg']['audio']['VBR_frames']) * 8) * ($ThisFileInfo['audio']['sample_rate'] / 576)) / 1000;
} else {
$ThisFileInfo['mpeg']['audio']['VBR_bitrate'] = ((($ThisFileInfo['mpeg']['audio']['VBR_bytes'] / $ThisFileInfo['mpeg']['audio']['VBR_frames']) * 8) * ($ThisFileInfo['audio']['sample_rate'] / 1152)) / 1000;
}
if ($ThisFileInfo['mpeg']['audio']['VBR_bitrate'] > 0) {
$ThisFileInfo['audio']['bitrate'] = 1000 * $ThisFileInfo['mpeg']['audio']['VBR_bitrate'];
$ThisFileInfo['mpeg']['audio']['bitrate'] = $ThisFileInfo['mpeg']['audio']['VBR_bitrate']; // to avoid confusion
}
}
// End variable-bitrate headers
////////////////////////////////////////////////////////////////////////////////////
if ($recursivesearch) {
if (!RecursiveFrameScanning($fd, $ThisFileInfo, $offset, $nextframetestoffset, $ScanAsCBR)) {
return false;
}
}
//if (false) {
// // experimental side info parsing section - not returning anything useful yet
//
// $SideInfoBitstream = BigEndian2Bin($SideInfoData);
// $SideInfoOffset = 0;
//
// if ($ThisFileInfo['mpeg']['audio']['version'] == '1') {
// if ($ThisFileInfo['mpeg']['audio']['channelmode'] == 'mono') {
// // MPEG-1 (mono)
// $ThisFileInfo['mpeg']['audio']['side_info']['main_data_begin'] = substr($SideInfoBitstream, $SideInfoOffset, 9);
// $SideInfoOffset += 9;
// $SideInfoOffset += 5;
// } else {
// // MPEG-1 (stereo, joint-stereo, dual-channel)
// $ThisFileInfo['mpeg']['audio']['side_info']['main_data_begin'] = substr($SideInfoBitstream, $SideInfoOffset, 9);
// $SideInfoOffset += 9;
// $SideInfoOffset += 3;
// }
// } else { // 2 or 2.5
// if ($ThisFileInfo['mpeg']['audio']['channelmode'] == 'mono') {
// // MPEG-2, MPEG-2.5 (mono)
// $ThisFileInfo['mpeg']['audio']['side_info']['main_data_begin'] = substr($SideInfoBitstream, $SideInfoOffset, 8);
// $SideInfoOffset += 8;
// $SideInfoOffset += 1;
// } else {
// // MPEG-2, MPEG-2.5 (stereo, joint-stereo, dual-channel)
// $ThisFileInfo['mpeg']['audio']['side_info']['main_data_begin'] = substr($SideInfoBitstream, $SideInfoOffset, 8);
// $SideInfoOffset += 8;
// $SideInfoOffset += 2;
// }
// }
//
// if ($ThisFileInfo['mpeg']['audio']['version'] == '1') {
// for ($channel = 0; $channel < $ThisFileInfo['audio']['channels']; $channel++) {
// for ($scfsi_band = 0; $scfsi_band < 4; $scfsi_band++) {
// $ThisFileInfo['mpeg']['audio']['scfsi'][$channel][$scfsi_band] = substr($SideInfoBitstream, $SideInfoOffset, 1);
// $SideInfoOffset += 2;
// }
// }
// }
// for ($granule = 0; $granule < (($ThisFileInfo['mpeg']['audio']['version'] == '1') ? 2 : 1); $granule++) {
// for ($channel = 0; $channel < $ThisFileInfo['audio']['channels']; $channel++) {
// $ThisFileInfo['mpeg']['audio']['part2_3_length'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 12);
// $SideInfoOffset += 12;
// $ThisFileInfo['mpeg']['audio']['big_values'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 9);
// $SideInfoOffset += 9;
// $ThisFileInfo['mpeg']['audio']['global_gain'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 8);
// $SideInfoOffset += 8;
// if ($ThisFileInfo['mpeg']['audio']['version'] == '1') {
// $ThisFileInfo['mpeg']['audio']['scalefac_compress'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 4);
// $SideInfoOffset += 4;
// } else {
// $ThisFileInfo['mpeg']['audio']['scalefac_compress'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 9);
// $SideInfoOffset += 9;
// }
// $ThisFileInfo['mpeg']['audio']['window_switching_flag'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 1);
// $SideInfoOffset += 1;
//
// if ($ThisFileInfo['mpeg']['audio']['window_switching_flag'][$granule][$channel] == '1') {
//
// $ThisFileInfo['mpeg']['audio']['block_type'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 2);
// $SideInfoOffset += 2;
// $ThisFileInfo['mpeg']['audio']['mixed_block_flag'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 1);
// $SideInfoOffset += 1;
//
// for ($region = 0; $region < 2; $region++) {
// $ThisFileInfo['mpeg']['audio']['table_select'][$granule][$channel][$region] = substr($SideInfoBitstream, $SideInfoOffset, 5);
// $SideInfoOffset += 5;
// }
// $ThisFileInfo['mpeg']['audio']['table_select'][$granule][$channel][2] = 0;
//
// for ($window = 0; $window < 3; $window++) {
// $ThisFileInfo['mpeg']['audio']['subblock_gain'][$granule][$channel][$window] = substr($SideInfoBitstream, $SideInfoOffset, 3);
// $SideInfoOffset += 3;
// }
//
// } else {
//
// for ($region = 0; $region < 3; $region++) {
// $ThisFileInfo['mpeg']['audio']['table_select'][$granule][$channel][$region] = substr($SideInfoBitstream, $SideInfoOffset, 5);
// $SideInfoOffset += 5;
// }
//
// $ThisFileInfo['mpeg']['audio']['region0_count'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 4);
// $SideInfoOffset += 4;
// $ThisFileInfo['mpeg']['audio']['region1_count'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 3);
// $SideInfoOffset += 3;
// $ThisFileInfo['mpeg']['audio']['block_type'][$granule][$channel] = 0;
// }
//
// if ($ThisFileInfo['mpeg']['audio']['version'] == '1') {
// $ThisFileInfo['mpeg']['audio']['preflag'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 1);
// $SideInfoOffset += 1;
// }
// $ThisFileInfo['mpeg']['audio']['scalefac_scale'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 1);
// $SideInfoOffset += 1;
// $ThisFileInfo['mpeg']['audio']['count1table_select'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 1);
// $SideInfoOffset += 1;
// }
// }
//}
return true;
}
function RecursiveFrameScanning(&$fd, &$ThisFileInfo, &$offset, &$nextframetestoffset, $ScanAsCBR) {
for ($i = 0; $i < MPEG_VALID_CHECK_FRAMES; $i++) {
// check next MPEG_VALID_CHECK_FRAMES frames for validity, to make sure we haven't run across a false synch
if (($nextframetestoffset + 4) >= $ThisFileInfo['avdataend']) {
// end of file
return true;
}
$nextframetestarray = array('error'=>'', 'warning'=>'', 'avdataend'=>$ThisFileInfo['avdataend'], 'avdataoffset'=>$ThisFileInfo['avdataoffset']);
if (decodeMPEGaudioHeader($fd, $nextframetestoffset, $nextframetestarray, false)) {
if ($ScanAsCBR) {
// force CBR mode, used for trying to pick out invalid audio streams with
// valid(?) VBR headers, or VBR streams with no VBR header
if (!isset($nextframetestarray['mpeg']['audio']['bitrate']) || !isset($ThisFileInfo['mpeg']['audio']['bitrate']) || ($nextframetestarray['mpeg']['audio']['bitrate'] != $ThisFileInfo['mpeg']['audio']['bitrate'])) {
return false;
}
}
// next frame is OK, get ready to check the one after that
if (isset($nextframetestarray['mpeg']['audio']['framelength']) && ($nextframetestarray['mpeg']['audio']['framelength'] > 0)) {
$nextframetestoffset += $nextframetestarray['mpeg']['audio']['framelength'];
} else {
$ThisFileInfo['error'] .= "\n".'Frame at offset ('.$offset.') is has an invalid frame length.';
return false;
}
} else {
// next frame is not valid, note the error and fail, so scanning can contiue for a valid frame sequence
$ThisFileInfo['error'] .= "\n".'Frame at offset ('.$offset.') is valid, but the next one at ('.$nextframetestoffset.') is not.';
return false;
}
}
return true;
}
function FreeFormatFrameLength($fd, $offset, &$ThisFileInfo, $deepscan=false) {
fseek($fd, $offset, SEEK_SET);
$MPEGaudioData = fread($fd, 32768);
$SyncPattern1 = substr($MPEGaudioData, 0, 4);
// may be different pattern due to padding
$SyncPattern2 = $SyncPattern1{0}.$SyncPattern1{1}.chr(ord($SyncPattern1{2}) | 0x02).$SyncPattern1{3};
if ($SyncPattern2 === $SyncPattern1) {
$SyncPattern2 = $SyncPattern1{0}.$SyncPattern1{1}.chr(ord($SyncPattern1{2}) & 0xFD).$SyncPattern1{3};
}
$framelength = false;
$framelength1 = strpos($MPEGaudioData, $SyncPattern1, 4);
$framelength2 = strpos($MPEGaudioData, $SyncPattern2, 4);
if ($framelength1 > 4) {
$framelength = $framelength1;
}
if (($framelength2 > 4) && ($framelength2 < $framelength1)) {
$framelength = $framelength2;
}
if (!$framelength) {
// LAME 3.88 has a different value for modeextension on the first frame vs the rest
$framelength1 = strpos($MPEGaudioData, substr($SyncPattern1, 0, 3), 4);
$framelength2 = strpos($MPEGaudioData, substr($SyncPattern2, 0, 3), 4);
if ($framelength1 > 4) {
$framelength = $framelength1;
}
if (($framelength2 > 4) && ($framelength2 < $framelength1)) {
$framelength = $framelength2;
}
if (!$framelength) {
$ThisFileInfo['error'] .= "\n".'Cannot find next free-format synch pattern ('.PrintHexBytes($SyncPattern1).' or '.PrintHexBytes($SyncPattern2).') after offset '.$offset;
return false;
} else {
$ThisFileInfo['warning'] .= "\n".'ModeExtension varies between first frame and other frames (known free-format issue in LAME 3.88)';
$ThisFileInfo['audio']['codec'] = 'LAME';
$ThisFileInfo['audio']['encoder'] = 'LAME3.88';
$SyncPattern1 = substr($SyncPattern1, 0, 3);
$SyncPattern2 = substr($SyncPattern2, 0, 3);
}
}
if ($deepscan) {
$ActualFrameLengthValues = array();
$nextoffset = $offset + $framelength;
while ($nextoffset < ($ThisFileInfo['avdataend'] - 6)) {
fseek($fd, $nextoffset - 1, SEEK_SET);
$NextSyncPattern = fread($fd, 6);
if ((substr($NextSyncPattern, 1, strlen($SyncPattern1)) == $SyncPattern1) || (substr($NextSyncPattern, 1, strlen($SyncPattern2)) == $SyncPattern2)) {
// good - found where expected
$ActualFrameLengthValues[] = $framelength;
} elseif ((substr($NextSyncPattern, 0, strlen($SyncPattern1)) == $SyncPattern1) || (substr($NextSyncPattern, 0, strlen($SyncPattern2)) == $SyncPattern2)) {
// ok - found one byte earlier than expected (last frame wasn't padded, first frame was)
$ActualFrameLengthValues[] = ($framelength - 1);
$nextoffset--;
} elseif ((substr($NextSyncPattern, 2, strlen($SyncPattern1)) == $SyncPattern1) || (substr($NextSyncPattern, 2, strlen($SyncPattern2)) == $SyncPattern2)) {
// ok - found one byte later than expected (last frame was padded, first frame wasn't)
$ActualFrameLengthValues[] = ($framelength + 1);
$nextoffset++;
} else {
$ThisFileInfo['error'] .= "\n".'Did not find expected free-format sync pattern at offset '.$nextoffset;
return false;
}
$nextoffset += $framelength;
}
if (count($ActualFrameLengthValues) > 0) {
$framelength = round(array_sum($ActualFrameLengthValues) / count($ActualFrameLengthValues));
}
}
return $framelength;
}
function getOnlyMPEGaudioInfo($fd, &$ThisFileInfo, $avdataoffset, $BitrateHistogram=false) {
// looks for synch, decodes MPEG audio header
fseek($fd, $avdataoffset, SEEK_SET);
$header = '';
$SynchSeekOffset = 0;
if (!defined('CONST_FF')) {
define('CONST_FF', chr(0xFF));
define('CONST_E0', chr(0xE0));
}
static $MPEGaudioVersionLookup;
static $MPEGaudioLayerLookup;
static $MPEGaudioBitrateLookup;
if (empty($MPEGaudioVersionLookup)) {
$MPEGaudioVersionLookup = MPEGaudioVersionArray();
$MPEGaudioLayerLookup = MPEGaudioLayerArray();
$MPEGaudioBitrateLookup = MPEGaudioBitrateArray();
}
$header_len = strlen($header) - round(FREAD_BUFFER_SIZE / 2);
while (true) {
if (($SynchSeekOffset > $header_len) && (($avdataoffset + $SynchSeekOffset) < $ThisFileInfo['avdataend']) && !feof($fd)) {
if ($SynchSeekOffset > 131072) {
// if a synch's not found within the first 128k bytes, then give up
$ThisFileInfo['error'] .= "\n".'could not find valid MPEG synch within the first 131072 bytes';
if (isset($ThisFileInfo['audio']['bitrate'])) {
unset($ThisFileInfo['audio']['bitrate']);
}
if (isset($ThisFileInfo['mpeg']['audio'])) {
unset($ThisFileInfo['mpeg']['audio']);
}
if (isset($ThisFileInfo['mpeg']) && (!is_array($ThisFileInfo['mpeg']) || (count($ThisFileInfo['mpeg']) == 0))) {
unset($ThisFileInfo['mpeg']);
}
return false;
} elseif ($header .= fread($fd, FREAD_BUFFER_SIZE)) {
// great
$header_len = strlen($header) - round(FREAD_BUFFER_SIZE / 2);
} else {
$ThisFileInfo['error'] .= "\n".'could not find valid MPEG synch before end of file';
if (isset($ThisFileInfo['audio']['bitrate'])) {
unset($ThisFileInfo['audio']['bitrate']);
}
if (isset($ThisFileInfo['mpeg']['audio'])) {
unset($ThisFileInfo['mpeg']['audio']);
}
if (isset($ThisFileInfo['mpeg']) && (!is_array($ThisFileInfo['mpeg']) || (count($ThisFileInfo['mpeg']) == 0))) {
unset($ThisFileInfo['mpeg']);
}
return false;
}
}
if (($SynchSeekOffset + 1) >= strlen($header)) {
$ThisFileInfo['error'] .= "\n".'could not find valid MPEG synch before end of file';
return false;
}
if (($header{$SynchSeekOffset} == CONST_FF) && ($header{($SynchSeekOffset + 1)} > CONST_E0)) { // synch detected
if (!isset($FirstFrameThisfileInfo) && !isset($ThisFileInfo['mpeg']['audio'])) {
$FirstFrameThisfileInfo = $ThisFileInfo;
$FirstFrameAVDataOffset = $avdataoffset + $SynchSeekOffset;
if (!decodeMPEGaudioHeader($fd, $avdataoffset + $SynchSeekOffset, $FirstFrameThisfileInfo, false)) {
// if this is the first valid MPEG-audio frame, save it in case it's a VBR header frame and there's
// garbage between this frame and a valid sequence of MPEG-audio frames, to be restored below
unset($FirstFrameThisfileInfo);
}
}
$dummy = $ThisFileInfo; // only overwrite real data if valid header found
if (decodeMPEGaudioHeader($fd, $avdataoffset + $SynchSeekOffset, $dummy, true)) {
$ThisFileInfo = $dummy;
$ThisFileInfo['avdataoffset'] = $avdataoffset + $SynchSeekOffset;
switch ($ThisFileInfo['fileformat']) {
case '':
case 'id3':
case 'ape':
case 'mp3':
$ThisFileInfo['fileformat'] = 'mp3';
$ThisFileInfo['audio']['dataformat'] = 'mp3';
}
if (isset($FirstFrameThisfileInfo['mpeg']['audio']['bitrate_mode']) && ($FirstFrameThisfileInfo['mpeg']['audio']['bitrate_mode'] == 'vbr')) {
if (!CloseMatch($ThisFileInfo['audio']['bitrate'], $FirstFrameThisfileInfo['audio']['bitrate'], 1)) {
// If there is garbage data between a valid VBR header frame and a sequence
// of valid MPEG-audio frames the VBR data is no longer discarded.
$ThisFileInfo = $FirstFrameThisfileInfo;
$ThisFileInfo['avdataoffset'] = $FirstFrameAVDataOffset;
$ThisFileInfo['fileformat'] = 'mp3';
$ThisFileInfo['audio']['dataformat'] = 'mp3';
$dummy = $ThisFileInfo;
unset($dummy['mpeg']['audio']);
$GarbageOffsetStart = $FirstFrameAVDataOffset + $FirstFrameThisfileInfo['mpeg']['audio']['framelength'];
$GarbageOffsetEnd = $avdataoffset + $SynchSeekOffset;
if (decodeMPEGaudioHeader($fd, $GarbageOffsetEnd, $dummy, true, true)) {
$ThisFileInfo = $dummy;
$ThisFileInfo['avdataoffset'] = $GarbageOffsetEnd;
$ThisFileInfo['warning'] .= "\n".'apparently-valid VBR header not used because could not find '.MPEG_VALID_CHECK_FRAMES.' consecutive MPEG-audio frames immediately after VBR header (garbage data for '.($GarbageOffsetEnd - $GarbageOffsetStart).' bytes between '.$GarbageOffsetStart.' and '.$GarbageOffsetEnd.'), but did find valid CBR stream starting at '.$GarbageOffsetEnd;
} else {
$ThisFileInfo['warning'] .= "\n".'using data from VBR header even though could not find '.MPEG_VALID_CHECK_FRAMES.' consecutive MPEG-audio frames immediately after VBR header (garbage data for '.($GarbageOffsetEnd - $GarbageOffsetStart).' bytes between '.$GarbageOffsetStart.' and '.$GarbageOffsetEnd.')';
}
}
}
if (isset($ThisFileInfo['mpeg']['audio']['bitrate_mode']) && ($ThisFileInfo['mpeg']['audio']['bitrate_mode'] == 'vbr') && !isset($ThisFileInfo['mpeg']['audio']['VBR_method'])) {
// VBR file with no VBR header
$BitrateHistogram = true;
}
if ($BitrateHistogram) {
$ThisFileInfo['mpeg']['audio']['stereo_distribution'] = array('stereo'=>0, 'joint stereo'=>0, 'dual channel'=>0, 'mono'=>0);
$ThisFileInfo['mpeg']['audio']['version_distribution'] = array('1'=>0, '2'=>0, '2.5'=>0);
if ($ThisFileInfo['mpeg']['audio']['version'] == '1') {
if ($ThisFileInfo['mpeg']['audio']['layer'] == 'III') {
$ThisFileInfo['mpeg']['audio']['bitrate_distribution'] = array('free'=>0, 32=>0, 40=>0, 48=>0, 56=>0, 64=>0, 80=>0, 96=>0, 112=>0, 128=>0, 160=>0, 192=>0, 224=>0, 256=>0, 320=>0);
} elseif ($ThisFileInfo['mpeg']['audio']['layer'] == 'II') {
$ThisFileInfo['mpeg']['audio']['bitrate_distribution'] = array('free'=>0, 32=>0, 48=>0, 56=>0, 64=>0, 80=>0, 96=>0, 112=>0, 128=>0, 160=>0, 192=>0, 224=>0, 256=>0, 320=>0, 384=>0);
} elseif ($ThisFileInfo['mpeg']['audio']['layer'] == 'I') {
$ThisFileInfo['mpeg']['audio']['bitrate_distribution'] = array('free'=>0, 32=>0, 64=>0, 96=>0, 128=>0, 160=>0, 192=>0, 224=>0, 256=>0, 288=>0, 320=>0, 352=>0, 384=>0, 416=>0, 448=>0);
}
} elseif ($ThisFileInfo['mpeg']['audio']['layer'] == 'I') {
$ThisFileInfo['mpeg']['audio']['bitrate_distribution'] = array('free'=>0, 32=>0, 48=>0, 56=>0, 64=>0, 80=>0, 96=>0, 112=>0, 128=>0, 144=>0, 160=>0, 176=>0, 192=>0, 224=>0, 256=>0);
} else {
$ThisFileInfo['mpeg']['audio']['bitrate_distribution'] = array('free'=>0, 8=>0, 16=>0, 24=>0, 32=>0, 40=>0, 48=>0, 56=>0, 64=>0, 80=>0, 96=>0, 112=>0, 128=>0, 144=>0, 160=>0);
}
$dummy = array('error'=>$ThisFileInfo['error'], 'warning'=>$ThisFileInfo['warning'], 'avdataend'=>$ThisFileInfo['avdataend'], 'avdataoffset'=>$ThisFileInfo['avdataoffset']);
$synchstartoffset = $ThisFileInfo['avdataoffset'];
$FastMode = false;
while (decodeMPEGaudioHeader($fd, $synchstartoffset, $dummy, false, false, $FastMode)) {
$FastMode = true;
$thisframebitrate = $MPEGaudioBitrateLookup[$MPEGaudioVersionLookup[$dummy['mpeg']['audio']['raw']['version']]][$MPEGaudioLayerLookup[$dummy['mpeg']['audio']['raw']['layer']]][$dummy['mpeg']['audio']['raw']['bitrate']];
$ThisFileInfo['mpeg']['audio']['bitrate_distribution'][$thisframebitrate]++;
$ThisFileInfo['mpeg']['audio']['stereo_distribution'][$dummy['mpeg']['audio']['channelmode']]++;
$ThisFileInfo['mpeg']['audio']['version_distribution'][$dummy['mpeg']['audio']['version']]++;
if (empty($dummy['mpeg']['audio']['framelength'])) {
$ThisFileInfo['warning'] .= "\n".'Invalid/missing framelength in histogram analysis - aborting';
$synchstartoffset += 4;
// return false;
}
$synchstartoffset += $dummy['mpeg']['audio']['framelength'];
}
$bittotal = 0;
$framecounter = 0;
foreach ($ThisFileInfo['mpeg']['audio']['bitrate_distribution'] as $bitratevalue => $bitratecount) {
$framecounter += $bitratecount;
if ($bitratevalue != 'free') {
$bittotal += ($bitratevalue * $bitratecount);
}
}
if ($framecounter == 0) {
$ThisFileInfo['error'] .= "\n".'Corrupt MP3 file: framecounter == zero';
return false;
}
$ThisFileInfo['mpeg']['audio']['frame_count'] = $framecounter;
$ThisFileInfo['mpeg']['audio']['bitrate'] = 1000 * ($bittotal / $framecounter);
$ThisFileInfo['audio']['bitrate'] = $ThisFileInfo['mpeg']['audio']['bitrate'];
// Definitively set VBR vs CBR, even if the Xing/LAME/VBRI header says differently
$distinct_bitrates = 0;
foreach ($ThisFileInfo['mpeg']['audio']['bitrate_distribution'] as $bitrate_value => $bitrate_count) {
if ($bitrate_count > 0) {
$distinct_bitrates++;
}
}
if ($distinct_bitrates > 1) {
$ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'vbr';
} else {
$ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'cbr';
}
$ThisFileInfo['audio']['bitrate_mode'] = $ThisFileInfo['mpeg']['audio']['bitrate_mode'];
}
break; // exit while()
}
}
$SynchSeekOffset++;
if (($avdataoffset + $SynchSeekOffset) >= $ThisFileInfo['avdataend']) {
// end of file/data
if (empty($ThisFileInfo['mpeg']['audio'])) {
$ThisFileInfo['error'] .= "\n".'could not find valid MPEG synch before end of file';
if (isset($ThisFileInfo['audio']['bitrate'])) {
unset($ThisFileInfo['audio']['bitrate']);
}
if (isset($ThisFileInfo['mpeg']['audio'])) {
unset($ThisFileInfo['mpeg']['audio']);
}
if (isset($ThisFileInfo['mpeg']) && (!is_array($ThisFileInfo['mpeg']) || empty($ThisFileInfo['mpeg']))) {
unset($ThisFileInfo['mpeg']);
}
return false;
}
break;
}
}
$ThisFileInfo['audio']['bits_per_sample'] = 16;
$ThisFileInfo['audio']['channels'] = $ThisFileInfo['mpeg']['audio']['channels'];
$ThisFileInfo['audio']['channelmode'] = $ThisFileInfo['mpeg']['audio']['channelmode'];
$ThisFileInfo['audio']['sample_rate'] = $ThisFileInfo['mpeg']['audio']['sample_rate'];
return true;
}
function MPEGaudioVersionArray() {
static $MPEGaudioVersion = array('2.5', false, '2', '1');
return $MPEGaudioVersion;
}
function MPEGaudioLayerArray() {
static $MPEGaudioLayer = array(false, 'III', 'II', 'I');
return $MPEGaudioLayer;
}
function MPEGaudioBitrateArray() {
static $MPEGaudioBitrate;
if (empty($MPEGaudioBitrate)) {
$MPEGaudioBitrate['1']['I'] = array('free', 32, 64, 96, 128, 160, 192, 224, 256, 288, 320, 352, 384, 416, 448);
$MPEGaudioBitrate['1']['II'] = array('free', 32, 48, 56, 64, 80, 96, 112, 128, 160, 192, 224, 256, 320, 384);
$MPEGaudioBitrate['1']['III'] = array('free', 32, 40, 48, 56, 64, 80, 96, 112, 128, 160, 192, 224, 256, 320);
$MPEGaudioBitrate['2']['I'] = array('free', 32, 48, 56, 64, 80, 96, 112, 128, 144, 160, 176, 192, 224, 256);
$MPEGaudioBitrate['2']['II'] = array('free', 8, 16, 24, 32, 40, 48, 56, 64, 80, 96, 112, 128, 144, 160);
$MPEGaudioBitrate['2']['III'] = $MPEGaudioBitrate['2']['II'];
$MPEGaudioBitrate['2.5']['I'] = $MPEGaudioBitrate['2']['I'];
$MPEGaudioBitrate['2.5']['II'] = $MPEGaudioBitrate['2']['II'];
$MPEGaudioBitrate['2.5']['III'] = $MPEGaudioBitrate['2']['III'];
}
return $MPEGaudioBitrate;
}
function MPEGaudioFrequencyArray() {
static $MPEGaudioFrequency;
if (empty($MPEGaudioFrequency)) {
$MPEGaudioFrequency['1'] = array(44100, 48000, 32000);
$MPEGaudioFrequency['2'] = array(22050, 24000, 16000);
$MPEGaudioFrequency['2.5'] = array(11025, 12000, 8000);
}
return $MPEGaudioFrequency;
}
function MPEGaudioChannelModeArray() {
static $MPEGaudioChannelMode = array('stereo', 'joint stereo', 'dual channel', 'mono');
return $MPEGaudioChannelMode;
}
function MPEGaudioModeExtensionArray() {
static $MPEGaudioModeExtension;
if (empty($MPEGaudioModeExtension)) {
$MPEGaudioModeExtension['I'] = array('4-31', '8-31', '12-31', '16-31');
$MPEGaudioModeExtension['II'] = array('4-31', '8-31', '12-31', '16-31');
$MPEGaudioModeExtension['III'] = array('', 'IS', 'MS', 'IS+MS');
}
return $MPEGaudioModeExtension;
}
function MPEGaudioEmphasisArray() {
static $MPEGaudioEmphasis = array('none', '50/15ms', false, 'CCIT J.17');
return $MPEGaudioEmphasis;
}
function MPEGaudioHeaderBytesValid($head4) {
return MPEGaudioHeaderValid(MPEGaudioHeaderDecode($head4));
}
function MPEGaudioHeaderValid($rawarray, $echoerrors=false) {
if (($rawarray['synch'] & 0x0FFE) != 0x0FFE) {
return false;
}
static $MPEGaudioVersionLookup;
static $MPEGaudioLayerLookup;
static $MPEGaudioBitrateLookup;
static $MPEGaudioFrequencyLookup;
static $MPEGaudioChannelModeLookup;
static $MPEGaudioModeExtensionLookup;
static $MPEGaudioEmphasisLookup;
if (empty($MPEGaudioVersionLookup)) {
$MPEGaudioVersionLookup = MPEGaudioVersionArray();
$MPEGaudioLayerLookup = MPEGaudioLayerArray();
$MPEGaudioBitrateLookup = MPEGaudioBitrateArray();
$MPEGaudioFrequencyLookup = MPEGaudioFrequencyArray();
$MPEGaudioChannelModeLookup = MPEGaudioChannelModeArray();
$MPEGaudioModeExtensionLookup = MPEGaudioModeExtensionArray();
$MPEGaudioEmphasisLookup = MPEGaudioEmphasisArray();
}
if (isset($MPEGaudioVersionLookup[$rawarray['version']])) {
$decodedVersion = $MPEGaudioVersionLookup[$rawarray['version']];
} else {
if ($echoerrors) {
echo "\n".'invalid Version ('.$rawarray['version'].')';
}
return false;
}
if (isset($MPEGaudioLayerLookup[$rawarray['layer']])) {
$decodedLayer = $MPEGaudioLayerLookup[$rawarray['layer']];
} else {
if ($echoerrors) {
echo "\n".'invalid Layer ('.$rawarray['layer'].')';
}
return false;
}
if (!isset($MPEGaudioBitrateLookup[$decodedVersion][$decodedLayer][$rawarray['bitrate']])) {
if ($echoerrors) {
echo "\n".'invalid Bitrate ('.$rawarray['bitrate'].')';
}
if ($rawarray['bitrate'] == 15) {
// known issue in LAME 3.90 - 3.93.1 where free-format has bitrate ID of 15 instead of 0
// let it go through here otherwise file will not be identified
} else {
return false;
}
}
if (!isset($MPEGaudioFrequencyLookup[$decodedVersion][$rawarray['sample_rate']])) {
if ($echoerrors) {
echo "\n".'invalid Frequency ('.$rawarray['sample_rate'].')';
}
return false;
}
if (!isset($MPEGaudioChannelModeLookup[$rawarray['channelmode']])) {
if ($echoerrors) {
echo "\n".'invalid ChannelMode ('.$rawarray['channelmode'].')';
}
return false;
}
if (!isset($MPEGaudioModeExtensionLookup[$decodedLayer][$rawarray['modeextension']])) {
if ($echoerrors) {
echo "\n".'invalid Mode Extension ('.$rawarray['modeextension'].')';
}
return false;
}
if (!isset($MPEGaudioEmphasisLookup[$rawarray['emphasis']])) {
if ($echoerrors) {
echo "\n".'invalid Emphasis ('.$rawarray['emphasis'].')';
}
return false;
}
// These are just either set or not set, you can't mess that up :)
// $rawarray['protection'];
// $rawarray['padding'];
// $rawarray['private'];
// $rawarray['copyright'];
// $rawarray['original'];
return true;
}
function MPEGaudioHeaderDecode($Header4Bytes) {
// AAAA AAAA AAAB BCCD EEEE FFGH IIJJ KLMM
// A - Frame sync (all bits set)
// B - MPEG Audio version ID
// C - Layer description
// D - Protection bit
// E - Bitrate index
// F - Sampling rate frequency index
// G - Padding bit
// H - Private bit
// I - Channel Mode
// J - Mode extension (Only if Joint stereo)
// K - Copyright
// L - Original
// M - Emphasis
if (strlen($Header4Bytes) != 4) {
return false;
}
$MPEGrawHeader['synch'] = (BigEndian2Int(substr($Header4Bytes, 0, 2)) & 0xFFE0) >> 4;
$MPEGrawHeader['version'] = (ord($Header4Bytes{1}) & 0x18) >> 3; // BB
$MPEGrawHeader['layer'] = (ord($Header4Bytes{1}) & 0x06) >> 1; // CC
$MPEGrawHeader['protection'] = (ord($Header4Bytes{1}) & 0x01); // D
$MPEGrawHeader['bitrate'] = (ord($Header4Bytes{2}) & 0xF0) >> 4; // EEEE
$MPEGrawHeader['sample_rate'] = (ord($Header4Bytes{2}) & 0x0C) >> 2; // FF
$MPEGrawHeader['padding'] = (ord($Header4Bytes{2}) & 0x02) >> 1; // G
$MPEGrawHeader['private'] = (ord($Header4Bytes{2}) & 0x01); // H
$MPEGrawHeader['channelmode'] = (ord($Header4Bytes{3}) & 0xC0) >> 6; // II
$MPEGrawHeader['modeextension'] = (ord($Header4Bytes{3}) & 0x30) >> 4; // JJ
$MPEGrawHeader['copyright'] = (ord($Header4Bytes{3}) & 0x08) >> 3; // K
$MPEGrawHeader['original'] = (ord($Header4Bytes{3}) & 0x04) >> 2; // L
$MPEGrawHeader['emphasis'] = (ord($Header4Bytes{3}) & 0x03); // MM
return $MPEGrawHeader;
}
function MPEGaudioFrameLength(&$bitrate, &$version, &$layer, $padding, &$samplerate) {
static $AudioFrameLengthCache = array();
if (!isset($AudioFrameLengthCache[$bitrate][$version][$layer][$padding][$samplerate])) {
$AudioFrameLengthCache[$bitrate][$version][$layer][$padding][$samplerate] = false;
if ($bitrate != 'free') {
if ($version == '1') {
if ($layer == 'I') {
// For Layer I slot is 32 bits long
$FrameLengthCoefficient = 48;
$SlotLength = 4;
} else { // Layer II / III
// for Layer II and Layer III slot is 8 bits long.
$FrameLengthCoefficient = 144;
$SlotLength = 1;
}
} else { // MPEG-2 / MPEG-2.5
if ($layer == 'I') {
// For Layer I slot is 32 bits long
$FrameLengthCoefficient = 24;
$SlotLength = 4;
} elseif ($layer == 'II') {
// for Layer II and Layer III slot is 8 bits long.
$FrameLengthCoefficient = 144;
$SlotLength = 1;
} else { // III
// for Layer II and Layer III slot is 8 bits long.
$FrameLengthCoefficient = 72;
$SlotLength = 1;
}
}
// FrameLengthInBytes = ((Coefficient * BitRate) / SampleRate) + Padding
// http://66.96.216.160/cgi-bin/YaBB.pl?board=c&action=display&num=1018474068
// -> [Finding the next frame synch] on www.r3mix.net forums if the above link goes dead
if ($samplerate > 0) {
$NewFramelength = ($FrameLengthCoefficient * $bitrate * 1000) / $samplerate;
$NewFramelength = floor($NewFramelength / $SlotLength) * $SlotLength; // round to next-lower multiple of SlotLength (1 byte for Layer II/III, 4 bytes for Layer I)
if ($padding) {
$NewFramelength += $SlotLength;
}
$AudioFrameLengthCache[$bitrate][$version][$layer][$padding][$samplerate] = (int) $NewFramelength;
}
}
}
return $AudioFrameLengthCache[$bitrate][$version][$layer][$padding][$samplerate];
}
function LAMEvbrMethodLookup($VBRmethodID) {
static $LAMEvbrMethodLookup = array();
if (empty($LAMEvbrMethodLookup)) {
$LAMEvbrMethodLookup[0x00] = 'unknown';
$LAMEvbrMethodLookup[0x01] = 'cbr';
$LAMEvbrMethodLookup[0x02] = 'abr';
$LAMEvbrMethodLookup[0x03] = 'vbr-old / vbr-rh';
$LAMEvbrMethodLookup[0x04] = 'vbr-mtrh';
$LAMEvbrMethodLookup[0x05] = 'vbr-new / vbr-mt';
}
return (isset($LAMEvbrMethodLookup[$VBRmethodID]) ? $LAMEvbrMethodLookup[$VBRmethodID] : '');
}
function LAMEmiscStereoModeLookup($StereoModeID) {
static $LAMEmiscStereoModeLookup = array();
if (empty($LAMEmiscStereoModeLookup)) {
$LAMEmiscStereoModeLookup[0] = 'mono';
$LAMEmiscStereoModeLookup[1] = 'stereo';
$LAMEmiscStereoModeLookup[2] = 'dual';
$LAMEmiscStereoModeLookup[3] = 'joint';
$LAMEmiscStereoModeLookup[4] = 'forced';
$LAMEmiscStereoModeLookup[5] = 'auto';
$LAMEmiscStereoModeLookup[6] = 'intensity';
$LAMEmiscStereoModeLookup[7] = 'other';
}
return (isset($LAMEmiscStereoModeLookup[$StereoModeID]) ? $LAMEmiscStereoModeLookup[$StereoModeID] : '');
}
function LAMEmiscSourceSampleFrequencyLookup($SourceSampleFrequencyID) {
static $LAMEmiscSourceSampleFrequencyLookup = array();
if (empty($LAMEmiscSourceSampleFrequencyLookup)) {
$LAMEmiscSourceSampleFrequencyLookup[0] = '<= 32 kHz';
$LAMEmiscSourceSampleFrequencyLookup[1] = '44.1 kHz';
$LAMEmiscSourceSampleFrequencyLookup[2] = '48 kHz';
$LAMEmiscSourceSampleFrequencyLookup[3] = '> 48kHz';
}
return (isset($LAMEmiscSourceSampleFrequencyLookup[$SourceSampleFrequencyID]) ? $LAMEmiscSourceSampleFrequencyLookup[$SourceSampleFrequencyID] : '');
}
function LAMEsurroundInfoLookup($SurroundInfoID) {
static $LAMEsurroundInfoLookup = array();
if (empty($LAMEsurroundInfoLookup)) {
$LAMEsurroundInfoLookup[0] = 'no surround info';
$LAMEsurroundInfoLookup[1] = 'DPL encoding';
$LAMEsurroundInfoLookup[2] = 'DPL2 encoding';
$LAMEsurroundInfoLookup[3] = 'Ambisonic encoding';
}
return (isset($LAMEsurroundInfoLookup[$SurroundInfoID]) ? $LAMEsurroundInfoLookup[$SurroundInfoID] : 'reserved');
}
?>